
CAS 14511-67-2
:1,2,3,10-Tetramethoxybenzo[a]heptalen-9(5H)-one
Description:
1,2,3,10-Tetramethoxybenzo[a]heptalen-9(5H)-one, with the CAS number 14511-67-2, is a polycyclic aromatic compound characterized by its complex structure, which includes a fused ring system and multiple methoxy groups. This compound features a benzo[a]heptalene core, which is a derivative of heptalene, and is substituted with four methoxy (-OCH₃) groups at specific positions on the aromatic rings. The presence of these methoxy groups significantly influences its chemical properties, including solubility and reactivity. Typically, such compounds exhibit interesting optical and electronic properties, making them of interest in materials science and organic electronics. Additionally, the compound may possess biological activity, although specific studies would be required to elucidate its potential pharmacological effects. Its synthesis and characterization would involve standard organic chemistry techniques, including spectroscopic methods for confirmation of structure. Overall, 1,2,3,10-Tetramethoxybenzo[a]heptalen-9(5H)-one represents a fascinating subject for further research in both synthetic and applied chemistry.
Formula:C20H20O5
InChI:InChI=1S/C20H20O5/c1-22-16-9-8-14-12(10-15(16)21)6-5-7-13-11-17(23-2)19(24-3)20(25-4)18(13)14/h5-6,8-11H,7H2,1-4H3
InChI key:InChIKey=MUVLDRPTYGNBAI-UHFFFAOYSA-N
SMILES:O(C)C1=C2C=3C(=CC(=O)C(OC)=CC3)C=CCC2=CC(OC)=C1OC
Synonyms:- Deacetamido-6-dehydrocolchicine
- Benzo[a]heptalen-9(5H)-one, 1,2,3,10-tetramethoxy-
- 1,2,3,10-Tetramethoxybenzo[a]heptalen-9(5H)-one
- Colchicine, deacetamido-6-dehydro-
- Colchicine, deacetamido-5,6-didehydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Colchicine, deacetamido-5,6-didehydro-
CAS:Colchicine, deacetamido-5,6-didehydro- is a biochemical.Formula:C20H20O5Color and Shape:SolidMolecular weight:340.37
