CAS 145119-18-2

1,1-Dimethylethyl 3-[2-[[(1,1-dimethylethoxy)carbonyl]amino]ethoxy]propanoate

Description:

1,1-Dimethylethyl 3-[2-[[(1,1-dimethylethoxy)carbonyl]amino]ethoxy]propanoate, identified by its CAS number 145119-18-2, is a chemical compound characterized by its complex structure, which includes multiple functional groups. This substance features an ester functional group, indicative of its potential reactivity and applications in organic synthesis. The presence of dimethyl groups suggests steric hindrance, which can influence its reactivity and interactions with other molecules. Additionally, the compound contains an amino group, which may impart basic properties and facilitate hydrogen bonding. The ethoxy and carbonyl functionalities contribute to its solubility and polarity, making it suitable for various chemical reactions. Overall, this compound's unique structural features may allow it to serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals, although specific applications would depend on further research and characterization. Its stability, reactivity, and potential uses would need to be evaluated in the context of its chemical behavior and interactions with other substances.

Formula: C₁₄H₂₇NO₅

InChI: InChI=1S/C14H27NO5/c1-13(2,3)19-11(16)7-9-18-10-8-15-12(17)20-14(4,5)6/h7-10H2,1-6H3,(H,15,17)

InChI key: InChIKey=ZGRQFPUTXUDCAO-UHFFFAOYSA-N

SMILES: C(CCOCCNC(OC(C)(C)C)=O)(OC(C)(C)C)=O

Synonyms:

• 1,1-Dimethylethyl 3-[2-[[(1,1-dimethylethoxy)carbonyl]amino]ethoxy]propanoate
• tert-Butyl 3-[2-(tert-butoxycarbonylamino)ethoxy]propionate
• Propanoic acid, 3-[2-[[(1,1-dimethylethoxy)carbonyl]amino]ethoxy]-, 1,1-dimethylethyl ester

Ixekizumab

CAS: 145119-18-2

Ixekizumab

Purity: ≥95%

Ref: 54-BUP20467

N-Boc-PEG-t-butyl ester

CAS: 145119-18-2

N-Boc-PEG-t-butyl ester is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules.

Formula: C₁₄H₂₇NO₅

Color and Shape: Solid

Molecular weight: 289.37

Ref: TM-T38937