CAS 145129-54-0
:Methyl 2,5-dichlorothiophene-3-carboxylate
Description:
Methyl 2,5-dichlorothiophene-3-carboxylate is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. This compound features two chlorine substituents at the 2 and 5 positions of the thiophene ring, contributing to its reactivity and potential applications in various chemical reactions. The presence of a carboxylate group, specifically a methyl ester, at the 3 position enhances its solubility in organic solvents and may influence its biological activity. Methyl 2,5-dichlorothiophene-3-carboxylate is typically used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Its chlorinated structure may impart unique electronic properties, making it a candidate for further functionalization. Additionally, the compound's stability and reactivity can be influenced by the presence of the chlorine atoms, which can participate in nucleophilic substitution reactions. Overall, this compound is of interest for its potential applications in various fields, including materials science and medicinal chemistry.
Formula:C6H4Cl2O2S
InChI:InChI=1/C6H4Cl2O2S/c1-10-6(9)3-2-4(7)11-5(3)8/h2H,1H3
SMILES:COC(=O)c1cc(Cl)sc1Cl
Synonyms:- 2,5-Dichlorothiophene-3-carboxylic acid methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Methyl 2,5-dichlorothiophene-3-carboxylate, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C6H4Cl2O2SPurity:98%Color and Shape:Liquid, Clear colorless to white to pale yellowMolecular weight:211.06
