CAS 145134-61-8

6-Hydroxykaempferol 3-glucoside

Description:

6-Hydroxykaempferol 3-glucoside, with the CAS number 145134-61-8, is a flavonoid glycoside derived from kaempferol, a naturally occurring flavonoid found in various plants. This compound features a hydroxyl group at the 6-position of the kaempferol backbone and is glycosylated at the 3-position with a glucose moiety. It exhibits antioxidant properties, which contribute to its potential health benefits, including anti-inflammatory and anti-cancer effects. The presence of the glucose unit enhances its solubility in water, facilitating its bioavailability in biological systems. 6-Hydroxykaempferol 3-glucoside is often studied in the context of herbal medicine and functional foods, as it is found in various fruits, vegetables, and medicinal plants. Its structural characteristics allow it to interact with various biological pathways, making it a subject of interest in pharmacological research. Overall, this compound exemplifies the diverse roles that flavonoids play in plant biology and their potential applications in human health.

Formula: C₂₁H₂₀O₁₂

InChI: InChI=1S/C21H20O12/c22-6-11-14(26)17(29)18(30)21(32-11)33-20-16(28)12-10(5-9(24)13(25)15(12)27)31-19(20)7-1-3-8(23)4-2-7/h1-5,11,14,17-18,21-27,29-30H,6H2/t11-,14-,17+,18-,21+/m1/s1

InChI key: InChIKey=DIYGQKBUNSAYQA-CZTZGLBASA-N

SMILES: O(C1=C(OC=2C(C1=O)=C(O)C(O)=C(O)C2)C3=CC=C(O)C=C3)[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O

Synonyms:

• 6-Hydroxykaempferol 3-glucoside
• Scutellarein 3-O-glucoside
• 3-(β-D-Glucopyranosyloxy)-5,6,7-trihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one
• 4H-1-Benzopyran-4-one, 3-(β-D-glucopyranosyloxy)-5,6,7-trihydroxy-2-(4-hydroxyphenyl)-
• 6-Hydroxykaempferol 3-O-β-D-glucoside

6-Hydroxykaempferol 3-O-β-D-glucoside

CAS: 145134-61-8

Formula: C₂₁H₂₀O₁₂

Purity: 95%~99%

Molecular weight: 464.379

Ref: BP-BP4886

6-Hydroxykaempferol 3-o-β-D-glucoside

CAS: 145134-61-8

6-Hydroxykaempferol 3-o-β-D-glucoside is a flavonoid glycoside, a specialized class of compounds known for their antioxidant properties. This compound is typically derived from various plant sources, including fruits, vegetables, and certain herbal species, where it acts as a secondary metabolite. It functions primarily by modulating cellular pathways through its antioxidative effects, neutralizing free radicals and reducing oxidative stress within cells. This activity is crucial in mediating anti-inflammatory responses and maintaining cellular homeostasis.

Formula: C₂₁H₂₀O₁₂

Purity: Min. 95%

Molecular weight: 464.4 g/mol

Ref: 3D-VFA13461

6-Hydroxykaempferol 3-O-β-D-glucoside

CAS: 145134-61-8

6-Hydroxykaempferol 3-O-beta-D-glucoside has anti-thrombotic,and antioxidative activities.

Formula: C₂₁H₂₀O₁₂

Color and Shape: Solid

Molecular weight: 464.38

Ref: TM-TN1312