CAS 1451391-38-0

B-[4-(Hydroxymethyl)-2,3-dimethylphenyl]boronic acid

Description:

B-[4-(Hydroxymethyl)-2,3-dimethylphenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a substituted phenyl ring. The compound features a hydroxymethyl group and two methyl groups on the aromatic ring, which contribute to its unique chemical properties. Boronic acids are known for their ability to form reversible complexes with diols, making them valuable in various applications, including organic synthesis and medicinal chemistry. This specific compound may exhibit properties such as moderate solubility in polar solvents and potential reactivity in cross-coupling reactions, which are essential in the formation of carbon-carbon bonds. Additionally, the presence of the hydroxymethyl group can enhance its reactivity and solubility, while the methyl substituents may influence its steric and electronic characteristics. Overall, B-[4-(Hydroxymethyl)-2,3-dimethylphenyl]boronic acid is a versatile compound with potential applications in drug development and materials science.

Formula: C₉H₁₃BO₃

InChI: InChI=1S/C9H13BO3/c1-6-7(2)9(10(12)13)4-3-8(6)5-11/h3-4,11-13H,5H2,1-2H3

InChI key: InChIKey=NDYOOBLPKKGMTQ-UHFFFAOYSA-N

SMILES: B(O)(O)C1=C(C)C(C)=C(CO)C=C1

Synonyms:

• Boronic acid, B-[4-(hydroxymethyl)-2,3-dimethylphenyl]-
• B-[4-(Hydroxymethyl)-2,3-dimethylphenyl]boronic acid

[4-(Hydroxymethyl)-2,3-dimethyl-phenyl]boronicacid

CAS: 1451391-38-0

Formula: C₉H₁₃BO₃

Purity: 95%

Molecular weight: 180.0087

Ref: IN-DA01K64F

2,3-Dimethyl-4-hydroxymethylphenylboronic acid

CAS: 1451391-38-0

Purity: 98+%

Molecular weight: 180.0099945

Ref: 10-F627982