CAS 1451391-44-8

B-[4-[Bis(phenylmethyl)amino]-2,6-dimethylphenyl]boronic acid

Description:

B-[4-[Bis(phenylmethyl)amino]-2,6-dimethylphenyl]boronic acid is a boronic acid derivative characterized by its unique structure, which includes a boron atom bonded to a phenyl group and an amino group. This compound features a boron atom that can form reversible covalent bonds with diols, making it useful in various applications, particularly in organic synthesis and medicinal chemistry. The presence of the bis(phenylmethyl)amino group enhances its solubility and stability in organic solvents. Additionally, the 2,6-dimethylphenyl moiety contributes to its steric hindrance, which can influence its reactivity and selectivity in chemical reactions. Boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in forming carbon-carbon bonds. This compound may also exhibit potential biological activity, making it of interest in drug discovery and development. Overall, its structural features suggest versatility in both synthetic and biological contexts, highlighting its significance in modern chemistry.

Formula: C₂₂H₂₄BNO₂

InChI: InChI=1S/C22H24BNO2/c1-17-13-21(14-18(2)22(17)23(25)26)24(15-19-9-5-3-6-10-19)16-20-11-7-4-8-12-20/h3-14,25-26H,15-16H2,1-2H3

InChI key: InChIKey=UOILFPHQODZYGP-UHFFFAOYSA-N

SMILES: N(CC1=CC=CC=C1)(CC2=CC=CC=C2)C3=CC(C)=C(B(O)O)C(C)=C3

Synonyms:

• Boronic acid, B-[4-[bis(phenylmethyl)amino]-2,6-dimethylphenyl]-
• B-[4-[Bis(phenylmethyl)amino]-2,6-dimethylphenyl]boronic acid

4-(Dibenzylamino)-2,6-dimethylphenylboronic acid

CAS: 1451391-44-8

Formula: C₂₂H₂₄BNO₂

Purity: 95%

Molecular weight: 345.2425

Ref: IN-DA01K6OM

4-(Dibenzylamino)-2,6-dimethylphenylboronic acid

CAS: 1451391-44-8

Purity: ≥95%

Molecular weight: 345.25

Ref: 10-F628006