CAS 1451391-46-0

B-[3-(Hydroxymethyl)-5-methylphenyl]boronic acid

Description:

B-[3-(Hydroxymethyl)-5-methylphenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols. This compound features a phenyl ring substituted with a hydroxymethyl group and a methyl group, contributing to its unique reactivity and potential applications in organic synthesis and medicinal chemistry. The hydroxymethyl group enhances its solubility in polar solvents, while the boronic acid moiety allows for participation in Suzuki coupling reactions, making it valuable in the formation of carbon-carbon bonds. Additionally, boronic acids are often utilized in the development of sensors and drug delivery systems due to their ability to interact with biomolecules. The compound's structure suggests it may exhibit interesting biological activities, although specific biological properties would require further investigation. Overall, B-[3-(Hydroxymethyl)-5-methylphenyl]boronic acid represents a versatile building block in synthetic chemistry with potential applications in various fields.

Formula: C₈H₁₁BO₃

InChI: InChI=1S/C8H11BO3/c1-6-2-7(5-10)4-8(3-6)9(11)12/h2-4,10-12H,5H2,1H3

InChI key: InChIKey=XAHBYOREXCQDRQ-UHFFFAOYSA-N

SMILES: B(O)(O)C1=CC(CO)=CC(C)=C1

Synonyms:

• Boronic acid, B-[3-(hydroxymethyl)-5-methylphenyl]-
• B-[3-(Hydroxymethyl)-5-methylphenyl]boronic acid

Boronic acid, B-[3-(hydroxymethyl)-5-methylphenyl]-

CAS: 1451391-46-0

Formula: C₈H₁₁BO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 165.9821

Ref: IN-DA001KLZ

3-(Hydroxymethyl)-5-methylphenylboronic acid

CAS: 1451391-46-0

3-(Hydroxymethyl)-5-methylphenylboronic acid

Purity: 98%

Molecular weight: 165.98g/mol

Ref: 54-OR908498

(3-(Hydroxymethyl)-5-methylphenyl)boronic acid

CAS: 1451391-46-0

Purity: 98%

Molecular weight: 165.9799957

Ref: 10-F694041