CymitQuimica logo

CAS 1451392-04-3

:

B-(3-Chloro-5-fluoro-4-methoxyphenyl)boronic acid

Description:
B-(3-Chloro-5-fluoro-4-methoxyphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a substituted phenyl ring. The phenyl ring features a chlorine atom, a fluorine atom, and a methoxy group, which contribute to its unique chemical properties and reactivity. This compound is typically used in organic synthesis, particularly in cross-coupling reactions such as Suzuki-Miyaura coupling, which is valuable for forming carbon-carbon bonds. The presence of the boronic acid group allows for the formation of stable complexes with diols, making it useful in various applications, including medicinal chemistry and materials science. Additionally, the halogen substituents can influence the electronic properties of the molecule, potentially enhancing its reactivity and selectivity in chemical reactions. Overall, B-(3-Chloro-5-fluoro-4-methoxyphenyl)boronic acid is a versatile building block in synthetic organic chemistry, with implications in drug development and the creation of complex molecular architectures.
Formula:C7H7BClFO3
InChI:InChI=1S/C7H7BClFO3/c1-13-7-5(9)2-4(8(11)12)3-6(7)10/h2-3,11-12H,1H3
InChI key:InChIKey=DGIMNBNEOUYRII-UHFFFAOYSA-N
SMILES:O(C)C1=C(Cl)C=C(B(O)O)C=C1F
Synonyms:
  • B-(3-Chloro-5-fluoro-4-methoxyphenyl)boronic acid
  • Boronic acid, B-(3-chloro-5-fluoro-4-methoxyphenyl)-
Found 2 products.