CAS 1451392-06-5

B-[4-(Aminocarbonyl)-2-methoxyphenyl]boronic acid

Description:

B-[4-(Aminocarbonyl)-2-methoxyphenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and is widely used in organic synthesis and medicinal chemistry. This compound features a phenyl ring substituted with both an aminocarbonyl group and a methoxy group, contributing to its potential reactivity and solubility properties. The aminocarbonyl group can participate in various chemical reactions, including amide formation and coupling reactions, while the methoxy group may enhance the compound's lipophilicity and influence its biological activity. The boronic acid moiety is particularly valuable in Suzuki coupling reactions, facilitating the formation of carbon-carbon bonds. Overall, this compound's unique structural features make it a versatile building block in the synthesis of complex organic molecules and a potential candidate for applications in drug discovery and development.

Formula: C₈H₁₀BNO₄

InChI: InChI=1S/C8H10BNO4/c1-14-7-4-5(8(10)11)2-3-6(7)9(12)13/h2-4,12-13H,1H3,(H2,10,11)

InChI key: InChIKey=KQDWCRHVPXXVNU-UHFFFAOYSA-N

SMILES: O(C)C1=C(B(O)O)C=CC(C(N)=O)=C1

Synonyms:

• Boronic acid, B-[4-(aminocarbonyl)-2-methoxyphenyl]-
• (4-Carbamoyl-2-methoxyphenyl)boronic acid
• B-[4-(Aminocarbonyl)-2-methoxyphenyl]boronic acid

(4-Carbamoyl-2-methoxy-phenyl)boronicacid

CAS: 1451392-06-5

Formula: C₈H₁₀BNO₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 194.9803

Ref: IN-DA01FW19

4-Carbamoyl-2-methoxyphenylboronic acid

CAS: 1451392-06-5

Purity: ≥95%

Molecular weight: 194.9799957

Ref: 10-F627933