CAS 1451392-26-9

B-[2-Chloro-6-fluoro-3-(methoxymethoxy)phenyl]boronic acid

Description:

B-[2-Chloro-6-fluoro-3-(methoxymethoxy)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with a chlorine atom and a fluorine atom, which can influence its reactivity and biological activity. The methoxymethoxy group enhances its solubility and may affect its interaction with biological targets. This compound is typically used in the development of pharmaceuticals, particularly in the synthesis of compounds that inhibit specific enzymes or receptors. Its boronic acid moiety is particularly valuable in the context of drug discovery, as it can participate in Suzuki-Miyaura cross-coupling reactions, facilitating the formation of carbon-carbon bonds. Overall, the unique structural features of B-[2-Chloro-6-fluoro-3-(methoxymethoxy)phenyl]boronic acid contribute to its potential utility in various chemical and biological applications.

Formula: C₈H₉BClFO₄

InChI: InChI=1S/C8H9BClFO4/c1-14-4-15-6-3-2-5(11)7(8(6)10)9(12)13/h2-3,12-13H,4H2,1H3

InChI key: InChIKey=HEHSNQNHNZDAGM-UHFFFAOYSA-N

SMILES: B(O)(O)C1=C(Cl)C(OCOC)=CC=C1F

Synonyms:

• Boronic acid, B-[2-chloro-6-fluoro-3-(methoxymethoxy)phenyl]-
• B-[2-Chloro-6-fluoro-3-(methoxymethoxy)phenyl]boronic acid
• 2-Chloro-6-fluoro-3-(methoxymethoxy)phenylboronic acid

2-Chloro-6-fluoro-3-(methoxymethoxy)phenylboronic acid

CAS: 1451392-26-9

Purity: 98%

Molecular weight: 234.42

Ref: FT-C11039

2-Chloro-6-fluoro-3-(methoxymethoxy)phenylboronic acid

CAS: 1451392-26-9

Purity: ≥95%

Molecular weight: 234.4100037

Ref: 10-F628051