CAS 1451392-30-5

2-[4-(Methoxymethoxy)-2-methylphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

Description:

2-[4-(Methoxymethoxy)-2-methylphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique structural features, including a dioxaborolane ring and a substituted aromatic system. The presence of the methoxymethoxy group enhances its solubility and reactivity, making it suitable for various applications in organic synthesis and materials science. The compound's dioxaborolane structure contributes to its stability and potential as a boron source in chemical reactions, particularly in cross-coupling reactions and as a reagent in organic transformations. Additionally, the tetramethyl substitution on the dioxaborolane ring may influence its electronic properties and steric hindrance, affecting its reactivity and interaction with other molecules. Overall, this compound exemplifies the versatility of boron-containing compounds in synthetic chemistry, with potential implications in drug development and the creation of novel materials.

Formula: C₁₅H₂₃BO₄

InChI: InChI=1S/C15H23BO4/c1-11-9-12(18-10-17-6)7-8-13(11)16-19-14(2,3)15(4,5)20-16/h7-9H,10H2,1-6H3

InChI key: InChIKey=AFVKGNAATYMYBB-UHFFFAOYSA-N

SMILES: CC1=C(B2OC(C)(C)C(C)(C)O2)C=CC(OCOC)=C1

Synonyms:

• 1,3,2-Dioxaborolane, 2-[4-(methoxymethoxy)-2-methylphenyl]-4,4,5,5-tetramethyl-
• 2-[4-(Methoxymethoxy)-2-methylphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
• 2-Methyl-4-(methoxymethoxy)phenylboronic acid pinacol ester

2-Methyl-4-(methoxymethoxy)phenylboronic acid pinacol ester

CAS: 1451392-30-5

Formula: C₁₅H₂₃BO₄

Purity: 95%

Molecular weight: 278.1517

Ref: IN-DA01K6O6

2-Methyl-4-(methoxymethoxy)phenylboronic acid pinacol ester

CAS: 1451392-30-5

Purity: ≥95%

Molecular weight: 278.1600037

Ref: 10-F627820