CAS 1451392-88-3

B-(5-Bromo-1,3-benzodioxol-4-yl)boronic acid

Description:

B-(5-Bromo-1,3-benzodioxol-4-yl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a brominated benzodioxole moiety. This compound typically exhibits properties such as moderate solubility in polar organic solvents and can participate in various chemical reactions, including Suzuki coupling, which is significant in organic synthesis and medicinal chemistry. The bromine substituent enhances its reactivity, making it a useful intermediate in the synthesis of more complex organic molecules. Additionally, the boronic acid group allows for the formation of stable complexes with diols, which can be exploited in sensor applications and drug development. The compound's structure suggests potential applications in the fields of pharmaceuticals and materials science, particularly in the development of biologically active compounds and functional materials. As with many organoboron compounds, it is essential to handle it with care due to potential reactivity and toxicity associated with its components.

Formula: C₇H₆BBrO₄

InChI: InChI=1S/C7H6BBrO4/c9-4-1-2-5-7(13-3-12-5)6(4)8(10)11/h1-2,10-11H,3H2

InChI key: InChIKey=QYRRTVQPTCHAGY-UHFFFAOYSA-N

SMILES: B(O)(O)C1=C2C(=CC=C1Br)OCO2

Synonyms:

• B-(5-Bromo-1,3-benzodioxol-4-yl)boronic acid
• Boronic acid, B-(5-bromo-1,3-benzodioxol-4-yl)-

(5-bromobenzo[d][1,3]dioxol-4-yl)boronicacid

CAS: 1451392-88-3

Formula: C₇H₆BBrO₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 244.8351

Ref: IN-DA01K6R4

5-Bromobenzo[1,3]dioxole-4-boronic acid

CAS: 1451392-88-3

Purity: ≥95%

Molecular weight: 244.8399963

Ref: 10-F627952