CymitQuimica logo

CAS 1451392-99-6

:

B-(2,6-Dichloro-4-fluorophenyl)boronic acid

Description:
B-(2,6-Dichloro-4-fluorophenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is substituted with two chlorine atoms and one fluorine atom. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar organic solvents, and having moderate stability under standard conditions. The boronic acid moiety allows for participation in various chemical reactions, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The presence of halogen substituents can influence its reactivity and solubility, as well as its potential biological activity. Additionally, this compound may exhibit unique electronic properties due to the electron-withdrawing nature of the chlorine and fluorine substituents, which can affect its interactions in biological systems or materials science applications. Overall, B-(2,6-Dichloro-4-fluorophenyl)boronic acid is a versatile compound with significant utility in synthetic chemistry.
Formula:C6H4BCl2FO2
InChI:InChI=1S/C6H4BCl2FO2/c8-4-1-3(10)2-5(9)6(4)7(11)12/h1-2,11-12H
InChI key:InChIKey=KXQQDVRYPXXJCR-UHFFFAOYSA-N
SMILES:B(O)(O)C1=C(Cl)C=C(F)C=C1Cl
Synonyms:
  • (2,6-Dichloro-4-fluorophenyl)boronic acid
  • Boronic acid, B-(2,6-dichloro-4-fluorophenyl)-
  • B-(2,6-Dichloro-4-fluorophenyl)boronic acid
  • 2,6-Dichloro-4-fluorophenylboronic acid
Found 6 products.