CAS 1451393-21-7

B-[4-Bromo-2-chloro-5-(trifluoromethyl)phenyl]boronic acid

Description:

B-[4-Bromo-2-chloro-5-(trifluoromethyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with a bromine atom, a chlorine atom, and a trifluoromethyl group, which contribute to its unique electronic and steric properties. The trifluoromethyl group is particularly notable for enhancing lipophilicity and influencing the compound's reactivity. The presence of halogen substituents can also affect the compound's stability and solubility in different solvents. As a boronic acid, it can participate in Suzuki-Miyaura cross-coupling reactions, making it valuable in the synthesis of complex organic molecules. Overall, this compound's distinctive structure and functional groups make it a significant candidate for research in pharmaceuticals and materials science.

Formula: C₇H₄BBrClF₃O₂

InChI: InChI=1S/C7H4BBrClF3O2/c9-5-2-6(10)4(8(14)15)1-3(5)7(11,12)13/h1-2,14-15H

InChI key: InChIKey=SGGXNNDOQRLDIX-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=CC(B(O)O)=C(Cl)C=C1Br

Synonyms:

• Boronic acid, B-[4-bromo-2-chloro-5-(trifluoromethyl)phenyl]-
• B-[4-Bromo-2-chloro-5-(trifluoromethyl)phenyl]boronic acid

Boronic acid, B-[4-bromo-2-chloro-5-(trifluoromethyl)phenyl]-

CAS: 1451393-21-7

Formula: C₇H₄BBrClF₃O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 303.2687

Ref: IN-DA01K5BR

4-Bromo-2-Chloro-5-(trifluoromethyl)phenylboronic acid

CAS: 1451393-21-7

Purity: ≥95%

Molecular weight: 303.269989

Ref: 10-F627855