CAS 1451393-28-4

B-[3-[[(3,5-Dichlorophenyl)amino]carbonyl]-4-fluorophenyl]boronic acid

Description:

B-[3-[[(3,5-Dichlorophenyl)amino]carbonyl]-4-fluorophenyl]boronic acid is a boronic acid derivative characterized by its complex molecular structure, which includes a boron atom bonded to a phenyl group substituted with both a dichlorophenyl and a fluorophenyl moiety. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the dichlorophenyl and fluorophenyl groups can influence its solubility, reactivity, and biological activity, potentially enhancing its efficacy in targeted therapeutic applications. Additionally, the compound may exhibit specific interactions with biological targets, which can be explored for drug development. Its unique structure and functional groups suggest potential utility in the development of inhibitors or modulators in biochemical pathways. As with many boronic acids, it may also be sensitive to moisture and require careful handling and storage conditions to maintain its stability.

Formula: C₁₃H₉BCl₂FNO₃

InChI: InChI=1S/C13H9BCl2FNO3/c15-8-4-9(16)6-10(5-8)18-13(19)11-3-7(14(20)21)1-2-12(11)17/h1-6,20-21H,(H,18,19)

InChI key: InChIKey=HRLQHZOOWBUTLV-UHFFFAOYSA-N

SMILES: C(NC1=CC(Cl)=CC(Cl)=C1)(=O)C2=CC(B(O)O)=CC=C2F

Synonyms:

• B-[3-[[(3,5-Dichlorophenyl)amino]carbonyl]-4-fluorophenyl]boronic acid
• Boronic acid, B-[3-[[(3,5-dichlorophenyl)amino]carbonyl]-4-fluorophenyl]-

[3-[(3,5-Dichlorophenyl)carbamoyl]-4-fluoro-phenyl]boronicacid

CAS: 1451393-28-4

Formula: C₁₃H₉BCl₂FNO₃

Purity: 95%

Molecular weight: 327.9309

Ref: IN-DA01M85T

3-(3,5-Dichlorophenylcarbamoyl)-4-fluorophenylboronic acid

CAS: 1451393-28-4

Purity: ≥95%

Molecular weight: 327.9299927

Ref: 10-F628091