CAS 1451393-31-9

B-[3-[[(2-Chlorophenyl)amino]carbonyl]-4-fluorophenyl]boronic acid

Description:

B-[3-[[(2-Chlorophenyl)amino]carbonyl]-4-fluorophenyl]boronic acid, with the CAS number 1451393-31-9, is a boronic acid derivative characterized by its boron atom bonded to a phenyl group that contains both a chlorinated and a fluorinated aromatic system. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the chlorophenyl and fluorophenyl groups suggests potential biological activity, as these substituents can influence the compound's interaction with biological targets. Additionally, the carboxylic acid functionality contributes to its solubility in polar solvents and may enhance its reactivity. Overall, this compound's unique structural features position it as a valuable candidate for research in drug development and materials science, particularly in the context of targeted therapies and molecular recognition processes.

Formula: C₁₃H₁₀BClFNO₃

InChI: InChI=1S/C13H10BClFNO3/c15-10-3-1-2-4-12(10)17-13(18)9-7-8(14(19)20)5-6-11(9)16/h1-7,19-20H,(H,17,18)

InChI key: InChIKey=WVKIBWQZYSPCSY-UHFFFAOYSA-N

SMILES: C(NC1=C(Cl)C=CC=C1)(=O)C2=CC(B(O)O)=CC=C2F

Synonyms:

• Boronic acid, B-[3-[[(2-chlorophenyl)amino]carbonyl]-4-fluorophenyl]-
• B-[3-[[(2-Chlorophenyl)amino]carbonyl]-4-fluorophenyl]boronic acid

[3-[(2-Chlorophenyl)carbamoyl]-4-fluoro-phenyl]boronicacid

CAS: 1451393-31-9

Formula: C₁₃H₁₀BClFNO₃

Purity: 95%

Molecular weight: 293.4858

Ref: IN-DA01M84R

4-Fluoro-3-(2-chloro-phenylcarbamoyl)phenylboronic acid

CAS: 1451393-31-9

Purity: ≥95%

Molecular weight: 293.4899902

Ref: 10-F628092