CAS 1451393-42-2

B-[3-(Phenylmethoxy)-5-(trifluoromethyl)phenyl]boronic acid

Description:

B-[3-(Phenylmethoxy)-5-(trifluoromethyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a phenylmethoxy group, which enhances its lipophilicity and may influence its biological activity. The trifluoromethyl group is notable for imparting unique electronic properties, often enhancing the compound's stability and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its boronic acid functionality allows for participation in Suzuki-Miyaura cross-coupling reactions, a key method in the formation of carbon-carbon bonds in organic synthesis. Additionally, the presence of fluorine atoms can affect the compound's pharmacokinetic properties, making it of interest in drug development. Overall, this compound exemplifies the versatility of boronic acids in both synthetic and pharmaceutical chemistry.

Formula: C₁₄H₁₂BF₃O₃

InChI: InChI=1S/C14H12BF3O3/c16-14(17,18)11-6-12(15(19)20)8-13(7-11)21-9-10-4-2-1-3-5-10/h1-8,19-20H,9H2

InChI key: InChIKey=MHUAAZABXBWEPZ-UHFFFAOYSA-N

SMILES: O(CC1=CC=CC=C1)C2=CC(C(F)(F)F)=CC(B(O)O)=C2

Synonyms:

• Boronic acid, B-[3-(phenylmethoxy)-5-(trifluoromethyl)phenyl]-
• B-[3-(Phenylmethoxy)-5-(trifluoromethyl)phenyl]boronic acid

(3-(Benzyloxy)-5-(trifluoromethyl)phenyl)boronic acid

CAS: 1451393-42-2

Purity: ≥95%

Molecular weight: 296.0499878

Ref: 10-F694052