CAS 1451393-45-5

B-(2-Bromo-4-chlorophenyl)boronic acid

Description:

B-(2-Bromo-4-chlorophenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is substituted with both bromine and chlorine atoms. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar organic solvents. The presence of the boronic acid group allows it to participate in various chemical reactions, particularly in Suzuki-Miyaura cross-coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The bromine and chlorine substituents on the phenyl ring can influence the compound's reactivity and electronic properties, potentially enhancing its utility in the development of pharmaceuticals and agrochemicals. Additionally, boronic acids are known for their ability to form reversible complexes with diols, which can be exploited in sensor applications and drug delivery systems. Overall, B-(2-Bromo-4-chlorophenyl)boronic acid is a versatile compound with significant implications in synthetic organic chemistry.

Formula: C₆H₅BBrClO₂

InChI: InChI=1S/C6H5BBrClO2/c8-6-3-4(9)1-2-5(6)7(10)11/h1-3,10-11H

InChI key: InChIKey=GMMUCVGZXGOUNM-UHFFFAOYSA-N

SMILES: B(O)(O)C1=C(Br)C=C(Cl)C=C1

Synonyms:

• B-(2-Bromo-4-chlorophenyl)boronic acid
• (2-Bromo-4-chlorophenyl)boronic acid
• 2-Bromo-4-chlorophenylboronic acid
• Boronic acid, B-(2-bromo-4-chlorophenyl)-

2-Bromo-4-chlorophenylboronic acid

CAS: 1451393-45-5

Formula: C₆H₅BBrClO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 235.2707

Ref: IN-DA01DM9A

(2-Bromo-4-chlorophenyl)boronic acid

CAS: 1451393-45-5

(2-Bromo-4-chlorophenyl)boronic acid

Purity: 98%

Molecular weight: 235.27g/mol

Ref: 54-OR93876

2-BROMO-4-CHLOROPHENYLBORONIC ACID

CAS: 1451393-45-5

Formula: C₆H₅BBrClO₂

Purity: 98%

Molecular weight: 235.27

Ref: 10-F529910