CAS 1451393-48-8

B-[2-Bromo-3-(trifluoromethyl)phenyl]boronic acid

Description:

B-[2-Bromo-3-(trifluoromethyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various organic synthesis applications, particularly in cross-coupling reactions like Suzuki-Miyaura coupling. The compound features a bromine atom and a trifluoromethyl group attached to a phenyl ring, which can significantly influence its reactivity and solubility. The trifluoromethyl group is known for imparting unique electronic properties, enhancing the compound's lipophilicity and potentially affecting its biological activity. The presence of the boronic acid moiety allows for participation in diverse chemical transformations, making it valuable in medicinal chemistry and materials science. Additionally, the compound's structure suggests potential applications in the development of pharmaceuticals and agrochemicals, where selective reactivity and functionalization are crucial. Overall, B-[2-Bromo-3-(trifluoromethyl)phenyl]boronic acid is a versatile building block in synthetic organic chemistry.

Formula: C₇H₅BBrF₃O₂

InChI: InChI=1S/C7H5BBrF3O2/c9-6-4(7(10,11)12)2-1-3-5(6)8(13)14/h1-3,13-14H

InChI key: InChIKey=DGEDEAVZOHLRDU-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C(Br)C(B(O)O)=CC=C1

Synonyms:

• B-[2-Bromo-3-(trifluoromethyl)phenyl]boronic acid
• Boronic acid, B-[2-bromo-3-(trifluoromethyl)phenyl]-
• 2-Bromo-3-trifluoromethylphenylboronic acid

2-Bromo-3-trifluoromethylphenylboronic acid

CAS: 1451393-48-8

Formula: C₇H₅BBrF₃O₂

Purity: 95%

Molecular weight: 268.8236

Ref: IN-DA00HXDX

2-Bromo-3-trifluoromethylphenylboronic acid

CAS: 1451393-48-8

2-Bromo-3-trifluoromethylphenylboronic acid

Purity: 95%

Molecular weight: 268.82g/mol

Ref: 54-PC901645

(2-Bromo-3-(trifluoromethyl)phenyl)boronic acid

CAS: 1451393-48-8

Purity: ≥95%

Molecular weight: 268.8200073

Ref: 10-F694005