CAS 14516-54-2

Bromopentacarbonylmanganese

Description:

Bromopentacarbonylmanganese, with the CAS number 14516-54-2, is a coordination compound featuring manganese in a low oxidation state, typically +1. This compound consists of a manganese center coordinated to five carbonyl (CO) ligands and one bromine atom. The presence of carbonyl ligands imparts significant stability and contributes to the compound's unique reactivity profile. Bromopentacarbonylmanganese is characterized by its ability to participate in various chemical reactions, including substitution and oxidative processes, making it of interest in organometallic chemistry and catalysis. The compound is typically handled under inert atmospheres due to its sensitivity to moisture and air, which can lead to decomposition. Its applications may extend to areas such as organic synthesis and materials science, where manganese's catalytic properties can be exploited. Additionally, the compound's distinct color and physical properties can vary based on its purity and the conditions under which it is synthesized or stored. Overall, Bromopentacarbonylmanganese serves as a valuable example of transition metal carbonyl chemistry.

Formula: C₅BrMnO₅

InChI: InChI=1S/5CO.BrH.Mn/c5*1-2;;/h;;;;;1H;/q;;;;;;+1/p-1

InChI key: InChIKey=OESORJHGSXJTKX-UHFFFAOYSA-M

SMILES: [Mn+](C#O)(C#O)(C#O)(C#O)(C#O)[Br-]

Synonyms:

• (OC-6-22)-Bromopentacarbonylmanganese
• Manganese, bromopentacarbonyl-, (OC-6-22)-
• Manganese, bromopentacarbonyl-
• Bromopentacarbonylmanganese
• Pentacarbonylbromomanganese

Manganese, bromopentacarbonyl-, (OC-6-22)-

CAS: 14516-54-2

Formula: C₅H₅BrMnO₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 279.9322

Ref: IN-DA001KN5

Bromopentacarbonylmanganese(I)

CAS: 14516-54-2

Bromopentacarbonylmanganese(I)

Purity: 98%

Molecular weight: 274.89g/mol

Ref: 54-IN10367

Bromopentacarbonylmanganese(I)

CAS: 14516-54-2

Bromopentacarbonylmanganese(I) (BPCMn) is a carbonyl group that can be used as an organic photochemical gas sensor. BPCMn has been synthesized by the reaction of manganese with trifluoroacetic acid in the presence of light. The product was purified by column chromatography and recrystallization. The synthesis of BPCMn has been studied, and it has been shown that this molecule is soluble in chloroform, tetrahydrofuran, and benzene. It also reacts with hydrogen chloride to form a salt-like compound.

Formula: C₅BrMnO₅

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 274.89 g/mol

Ref: 3D-PAA51654

Manganese pentacarbonyl bromide, min. 98%

CAS: 14516-54-2

Manganese pentacarbonyl bromide, min. 98%

Formula: Mn(CO)₅Br

Purity: min. 98%

Color and Shape: yellow to orange xtl.

Molecular weight: 274.90

Ref: 08-25-1450