CAS 145165-10-2
:1-hydroxyoxaunomycin
Description:
1-Hydroxyoxaunomycin is a chemical compound that belongs to the class of natural products known as anthracyclines, which are primarily recognized for their use in cancer therapy due to their ability to intercalate DNA and inhibit topoisomerase II. This compound features a unique structure characterized by a hydroxyl group (-OH) attached to the oxo group in its molecular framework, which contributes to its biological activity. The presence of the hydroxy group can enhance its solubility and influence its pharmacokinetic properties. 1-Hydroxyoxaunomycin exhibits cytotoxic effects against various cancer cell lines, making it a subject of interest in medicinal chemistry and drug development. Its mechanism of action involves the generation of reactive oxygen species and the induction of apoptosis in cancer cells. Additionally, the compound's stability, bioavailability, and potential side effects are important considerations in its therapeutic application. Ongoing research aims to further elucidate its efficacy and safety profile in clinical settings.
Formula:C26H29NO11
InChI:InChI=1/C26H29NO11/c1-3-26(36)7-12(38-13-6-9(27)20(30)8(2)37-13)16-19(25(26)35)24(34)18-17(23(16)33)21(31)14-10(28)4-5-11(29)15(14)22(18)32/h4-5,8-9,12-13,20,25,28-30,33-36H,3,6-7,27H2,1-2H3
Synonyms:- 5,12-Naphthacenedione, 10-[(3-amino-2,3,6-trideoxy-α-L-lyxo-hexopyranosyl)oxy]-8-ethyl-7,8,9,10-tetrahydro-1,4,6,7,8,11-hexahydroxy-, [7R-(7α,8β,10β)]-
- 1-hydroxyoxaunomycin
- 1-Hydroxy-D788-7
- 3-ethyl-3,4,5,7,10,12-hexahydroxy-6,11-dioxo-1,2,3,4,6,11-hexahydrotetracen-1-yl 3-amino-2,3,6-trideoxyhexopyranoside
- 5,12-Naphthacenedione, 10-((3-amino-2,3,6-trideoxy-alpha-L-lyxo-hexopyranosyl)oxy)-8-ethyl-7,8,9,10-tetrahydro-1,4,6,7,8,11-hexahydroxy-, (7R-(7alpha,8beta,10beta))-
- 1-Hydroxyoxaunomycin
- 5,12-Naphthacenedione, 10-[(3-amino-2,3,6-trideoxy-α-L-lyxo-hexopyranosyl)oxy]-8-ethyl-7,8,9,10-tetrahydro-1,4,6,7,8,11-hexahydroxy-, [7R-(7α,8β,10β)]- (9CI)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Hydroxyoxaunomycin
CAS:1-Hydroxyoxaunomycin is an antibiotic that inhibits the growth of U210 cells as well as the synthesis of DNA and RNA, with IC50 values of 0.0005 μg/mL, 1.00 μg/mL, and 0.76 μg/mL, respectively.Formula:C26H29NO11Color and Shape:SolidMolecular weight:531.509
