CAS 145194-32-7
:[3-(4-{[1-(dimethylamino)propan-2-yl]oxy}phenyl)-1H-pyrazolo[3,4-b]pyridin-1-yl]acetic acid
Description:
The chemical substance known as [3-(4-{[1-(dimethylamino)propan-2-yl]oxy}phenyl)-1H-pyrazolo[3,4-b]pyridin-1-yl]acetic acid, with the CAS number 145194-32-7, is a complex organic compound characterized by its unique structural features. It contains a pyrazolo[3,4-b]pyridine core, which is fused to a phenyl group substituted with a dimethylamino-propan-2-yl ether. This structure suggests potential biological activity, particularly in pharmacological contexts, as compounds with similar frameworks often exhibit interactions with various biological targets. The presence of the acetic acid functional group indicates that it may possess acidic properties, influencing its solubility and reactivity in different environments. Additionally, the dimethylamino group can enhance lipophilicity, potentially affecting the compound's absorption and distribution in biological systems. Overall, this compound's intricate structure and functional groups suggest it may have applications in medicinal chemistry, although specific biological activities would require further investigation through empirical studies.
Formula:C19H22N4O3
InChI:InChI=1/C19H22N4O3/c1-13(11-22(2)3)26-15-8-6-14(7-9-15)18-16-5-4-10-20-19(16)23(21-18)12-17(24)25/h4-10,13H,11-12H2,1-3H3,(H,24,25)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Y 25510
CAS:<p>Y 25510 is a biochemical.</p>Formula:C19H22N4O3Color and Shape:SolidMolecular weight:354.4
