CAS 145202-66-0
:1H-Indole-3-ethanamine, N,N-dimethyl-5-(1H-1,2,4-triazol-1-ylmethyl)-, benzoate (1:1)
Description:
1H-Indole-3-ethanamine, N,N-dimethyl-5-(1H-1,2,4-triazol-1-ylmethyl)-, benzoate (1:1), with CAS number 145202-66-0, is a chemical compound characterized by its complex structure, which includes an indole moiety, a triazole ring, and a benzoate group. This compound typically exhibits properties associated with both indole and triazole derivatives, such as potential biological activity, including antimicrobial or antifungal properties. The presence of the dimethylamino group suggests enhanced lipophilicity, which may influence its pharmacokinetic profile. Additionally, the benzoate moiety can affect solubility and stability in various solvents. The compound may also participate in hydrogen bonding due to the presence of nitrogen atoms in the triazole and indole rings, which can play a crucial role in its interactions with biological targets. Overall, this compound's unique structural features may contribute to its potential applications in medicinal chemistry and drug development, although specific biological activities would require further investigation through experimental studies.
Formula:C15H19N5·C7H6O2
InChI:InChI=1S/C15H19N5.C7H6O2/c1-19(2)6-5-13-8-17-15-4-3-12(7-14(13)15)9-20-11-16-10-18-20;8-7(9)6-4-2-1-3-5-6/h3-4,7-8,10-11,17H,5-6,9H2,1-2H3;1-5H,(H,8,9)
InChI key:InChIKey=JPRXYLQNJJVCMZ-UHFFFAOYSA-N
SMILES:C(CN(C)C)C=1C=2C(NC1)=CC=C(CN3C=NC=N3)C2.C(O)(=O)C1=CC=CC=C1
Synonyms:- Rizatriptan benzoate
- MK 462
- Maxalt
- 1H-Indole-3-ethanamine, N,N-dimethyl-5-(1H-1,2,4-triazol-1-ylmethyl)-, monobenzoate
- 1H-Indole-3-ethanamine, N,N-dimethyl-5-(1H-1,2,4-triazol-1-ylmethyl)-, benzoate (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 15 products.
RIZATRIPTAN BENZOATE CRS
CAS:RIZATRIPTAN BENZOATE CRSFormula:C15H19N5Color and Shape:Added ModifiedMolecular weight:269.3449RIZATRIPTAN FOR SYSTEM SUITABILITY CRS
CAS:RIZATRIPTAN FOR SYSTEM SUITABILITY CRSFormula:C15H19N5Molecular weight:269.3449Rizatriptan benzoate
CAS:Rizatriptan benzoateFormula:C22H25N5O2Color and Shape:WhiteMolecular weight:391.20083Rizatriptan Benzoate
CAS:Analgesics, antipyretics and non-hormonal anti-inflammaFormula:C15H19N5·C7H6O2Color and Shape:PowderMolecular weight:269.16405Rizatriptan Benzoate
CAS:Formula:C15H19N5·C7H6O2Color and Shape:Off-White SolidMolecular weight:269.35 122.12Rizatriptan Benzoate
CAS:Formula:C15H19N5·C7H6O2Purity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:391.48Rizatriptan benzoate
CAS:Rizatriptan benzoate (MK-462 Benzoate) selectively binds to and activates serotonin (5-HT) 1B receptors and 5-HT 1D receptors providing relief of migraineFormula:C22H25N5O2Purity:99% - 99.79%Color and Shape:White To Off-White Crystalline PowderMolecular weight:391.47Ref: TM-T1512
10mg44.00€25mg74.00€50mg119.00€100mg173.00€200mg259.00€500mg437.00€1mL*10mM (DMSO)48.00€Rizatriptan benzoate
CAS:Formula:C15H19N5·C7H6O2Purity:≤ 0.5%Color and Shape:White or almost white powderMolecular weight:391.47Rizatriptan Benzoate
CAS:Controlled ProductApplications Rizatriptan Benzoate is a selective serotonin 5-HTID receptor agonist and used to treat migraine (1,2,3). It is structurally derived from tryptamine.
References (1) Cheng, H., et al.: Biopharm. Drug Dispos., 17, 17 (1996) (2) Su, M., et al.: Eur J Neurosci. 44, 2129 (2016)(3) Millson, D. S., et al.: Expert Opin Pharmacother. 1, 391 (2000)Formula:C15H19N5·C7H6O2Color and Shape:Light YellowMolecular weight:391.47N,N-Dimethyl-2-[5-(1,2,4-triazol-1-ylmethyl)-1H-indol-3-yl]ethylamine benzoate
CAS:Purity:97.0%Color and Shape:SolidMolecular weight:391.475Rizatriptan benzoate
CAS:5-HT1B/1D serotonin receptor agonist; anti-migraine agent; vasoconstrictiveFormula:C15H19N5•C7H6O2Purity:Min. 95%Color and Shape:PowderMolecular weight:391.47 g/mol













