
CAS 1452182-57-8
:2-Bromo-1-ethenyl-3,4-dimethoxybenzene
Description:
2-Bromo-1-ethenyl-3,4-dimethoxybenzene is an organic compound characterized by its bromine substituent and methoxy groups on a benzene ring. The presence of the ethenyl group indicates that it has a vinyl functional group, which contributes to its reactivity, particularly in electrophilic addition reactions. The methoxy groups, which are electron-donating, enhance the stability of the aromatic system and can influence the compound's reactivity and solubility. This compound is likely to be a colorless to pale yellow liquid or solid, depending on its purity and temperature. Its molecular structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the bromine atom can serve as a useful handle for further chemical modifications. Safety data should be consulted, as halogenated compounds can exhibit toxicity and environmental concerns. Overall, 2-Bromo-1-ethenyl-3,4-dimethoxybenzene is a versatile compound with significant implications in synthetic organic chemistry.
Formula:C10H11BrO2
InChI:InChI=1S/C10H11BrO2/c1-4-7-5-6-8(12-2)10(13-3)9(7)11/h4-6H,1H2,2-3H3
InChI key:InChIKey=BALAXTDPFQCHAV-UHFFFAOYSA-N
SMILES:O(C)C1=C(OC)C=CC(C=C)=C1Br
Synonyms:- 2-Bromo-1-ethenyl-3,4-dimethoxybenzene
- Benzene, 2-bromo-1-ethenyl-3,4-dimethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.