CAS 145224-94-8
:4-Morpholineethanesulfonic acid, hydrate (1:1)
Description:
4-Morpholineethanesulfonic acid, hydrate (1:1), commonly referred to as MES, is a zwitterionic buffer widely used in biochemical and molecular biology applications. It features a morpholine ring, which contributes to its solubility and stability in aqueous solutions. The substance is characterized by its ability to maintain a stable pH, typically in the range of 6.0 to 7.5, making it suitable for various biological experiments, including enzyme assays and cell culture. MES is known for its low absorbance in the UV range, which is advantageous for spectrophotometric measurements. As a hydrate, it contains water molecules in its structure, influencing its physical properties such as solubility and stability. The compound is generally considered non-toxic and is compatible with a wide range of biological systems. Its CAS number, 145224-94-8, allows for easy identification in chemical databases. Overall, MES is a valuable reagent in laboratory settings, particularly for applications requiring precise pH control.
Formula:C6H13NO4S·H2O
InChI:InChI=1S/C6H13NO4S.H2O/c8-12(9,10)6-3-7-1-4-11-5-2-7;/h1-6H2,(H,8,9,10);1H2
InChI key:InChIKey=MIIIXQJBDGSIKL-UHFFFAOYSA-N
SMILES:C(CS(=O)(=O)O)N1CCOCC1.O
Synonyms:- 2-Morpholinoethanesulfonic acid, monohydrate
- 4-Morpholineethanesulfonic acid hydrate (1:1)
- 4-Morpholineethanesulfonic acid, monohydrate
- Mes.H2O
- Mes・H2O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
MES monohydrate
CAS:MES monohydrate is an amphoteric ionic buffer that is a PH stabilizing reagent used for protein purification and enzyme assays.Formula:C6H15NO5SPurity:99.48%Color and Shape:SolidMolecular weight:213.2524-Morpholineethanesulfonic Acid Hydrate
CAS:Applications 4-Morpholineethanesulfonic Acid is used in the synthesis of nanotechnology and nanoparticles, as potential therapy towards Alzheimer’s.
References Liu, G. et al.: Methods. Mol. Biol., 610, 123 (2010); Neugart, F. et al.: Nano. Lett., 7, 3588 (2007)Formula:C6H13NO4S·H2OColor and Shape:White PowderMolecular weight:213.252MES monohydrate
CAS:MES buffer is a synthetic buffer commonly used in biological and biochemical experiments. It's known for its buffering capacity within the pH range of 5.5 to 6.7, making it suitable for various applications. It has good water solubility, chemical stability, and minimal interaction with metal ions, which is crucial for many biological systems.Formula:C6H13NO4S·H2OColor and Shape:White Off-White PowderMolecular weight:213.25 g/mol2-Morpholinoethanesulfonic acid hydrate
CAS:Formula:C6H15NO5SPurity:97%Color and Shape:Solid, Crystalline or PowderMolecular weight:213.25MES Monohydrate Buffer for molecular biology, 99%
CAS:Formula:C6H13NO4S·H2OPurity:min. 99%Color and Shape:White, Crystalline powder, Clear, ColourlessMolecular weight:213.25MES Monohydrate Buffer for cell culture, 99%, Endotoxin (BET) 0.05EU/mg
CAS:Formula:C6H13NO4S·H2OPurity:min. 99%Color and Shape:White, Crystalline powder, Clear, ColourlessMolecular weight:213.25MES Monohydrate Buffer extrapure, 99%
CAS:Formula:C6H13NO4S·H2OPurity:min. 99%Color and Shape:White, Crystalline powder, Clear, ColourlessMolecular weight:213.25MES Monohydrate Buffer for tissue culture, 99%
CAS:Formula:C6H13NO4S·H2OPurity:min. 99%Color and Shape:White, Crystalline powder, Clear, ColourlessMolecular weight:213.25





