CAS 145224-94-8: 4-Morpholineethanesulfonic acid, hydrate (1:1)
Description:4-Morpholineethanesulfonic acid, hydrate (1:1), commonly referred to as MES, is a zwitterionic buffer widely used in biochemical and molecular biology applications. It features a morpholine ring, which contributes to its solubility and stability in aqueous solutions. The substance is characterized by its ability to maintain a stable pH, typically in the range of 6.0 to 7.5, making it suitable for various biological experiments, including enzyme assays and cell culture. MES is known for its low absorbance in the UV range, which is advantageous for spectrophotometric measurements. As a hydrate, it contains water molecules in its structure, influencing its physical properties such as solubility and stability. The compound is generally considered non-toxic and is compatible with a wide range of biological systems. Its CAS number, 145224-94-8, allows for easy identification in chemical databases. Overall, MES is a valuable reagent in laboratory settings, particularly for applications requiring precise pH control.
Formula:C6H13NO4S·H2O
InChI:InChI=1S/C6H13NO4S.H2O/c8-12(9,10)6-3-7-1-4-11-5-2-7;/h1-6H2,(H,8,9,10);1H2
InChI key:InChIKey=MIIIXQJBDGSIKL-UHFFFAOYSA-N
SMILES:O=S(=O)(O)CCN1CCOCC1.O
- Synonyms:
- 2-Morpholinoethanesulfonic acid, monohydrate
- 4-Morpholineethanesulfonic acid hydrate (1:1)
- 4-Morpholineethanesulfonic acid, monohydrate
- Mes.H2O
- Mes・H2O
