CAS 14523-53-6
:spiro[4.5]dec-6-en-8-one
Description:
Spiro[4.5]dec-6-en-8-one is an organic compound characterized by its unique spirocyclic structure, which consists of two fused rings sharing a single carbon atom. This compound features a double bond at the 6-position and a ketone functional group at the 8-position, contributing to its reactivity and potential applications in organic synthesis. The spiro arrangement imparts distinctive stereochemical properties, influencing its physical and chemical behavior. Typically, spiro compounds exhibit interesting conformational dynamics and can participate in various chemical reactions, including cycloadditions and rearrangements. The presence of the double bond and the carbonyl group makes it susceptible to electrophilic attack, which can be exploited in synthetic pathways. Additionally, spiro[4.5]dec-6-en-8-one may exhibit biological activity, making it of interest in medicinal chemistry. Its relatively low molecular weight and specific structural features allow for potential applications in materials science and pharmaceuticals. Overall, spiro[4.5]dec-6-en-8-one is a compound of interest due to its unique structural characteristics and reactivity.
Formula:C10H14O
InChI:InChI=1/C10H14O/c11-9-3-7-10(8-4-9)5-1-2-6-10/h3,7H,1-2,4-6,8H2
SMILES:C1CCC2(C1)C=CC(=O)CC2
Synonyms:- Spiro(4.5)dec-6-ene-8-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Spiro[4.5]dec-6-en-8-one
CAS:Spiro[4.5]dec-6-en-8-one is a natural product isolated from the leaves of plants in Madagascar. It has an inhibitory effect on insects and was sampled by researchers at the University of Florida. Spiro[4.5]dec-6-en-8-one can be extracted from camphene, naphthalene, and solenopsis. The compound inhibits the growth of insects through its inhibitory effects on protein synthesis by binding to ribosomal RNA. This activity is more pronounced in insect cells than in human cells, which may be due to a lower expression of ribosomal RNA in human cells.Formula:C10H14OPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:150.22 g/mol

