
CAS 145250-81-3
:1,1-Diamino-2,2-dinitroethylene
Description:
1,1-Diamino-2,2-dinitroethylene, commonly referred to as DADNE, is a chemical compound notable for its application in the field of explosives and propellants. It is characterized by its molecular structure, which includes two amino groups and two nitro groups attached to a central ethylene backbone. This configuration contributes to its energetic properties, making it a potential candidate for use in military and industrial applications. DADNE is typically a solid at room temperature and exhibits a high degree of stability under normal conditions, although it can be sensitive to heat and shock, which necessitates careful handling. The compound is also known for its relatively low sensitivity compared to other high explosives, which can be advantageous in certain applications. Additionally, its synthesis involves specific chemical reactions that require controlled conditions to ensure safety and yield. Overall, 1,1-Diamino-2,2-dinitroethylene represents a significant interest in materials science and energetic materials research due to its unique properties and potential uses.
Formula:C2H4N4O4
InChI:InChI=1S/C2H4N4O4/c3-1(4)2(5(7)8)6(9)10/h3-4H2
InChI key:InChIKey=FUHQFAMVYDIUKL-UHFFFAOYSA-N
SMILES:C(=C(N)N)(N(=O)=O)N(=O)=O
Synonyms:- FOX 7
- 2,2-Dinitro-1,1-ethenediamine
- 1,1-Diamino-2,2-dinitroethene
- 1,1-Ethenediamine, 2,2-dinitro-
- 1,1-Diamino-2,2-dinitroethylene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
FOX-7
CAS:<p>Fox-7, also known as DADNE, is a nitroamine high explosive related to the robust TATB.</p>Formula:C2H4N4O4Color and Shape:SolidMolecular weight:148.08
