CAS 145251-89-4
:2-(TRIISOPROPYLSILYL)-1 3-DITHIANE
Description:
2-(Triisopropylsilyl)-1,3-dithiane is an organosilicon compound characterized by the presence of a dithiane ring, which consists of two sulfur atoms and four carbon atoms, and is substituted with a triisopropylsilyl group. This compound typically exhibits properties associated with both sulfur-containing heterocycles and silanes. The triisopropylsilyl group enhances its stability and solubility in organic solvents, making it useful in various synthetic applications, particularly in organic synthesis and as a protecting group in the functionalization of other molecules. The presence of sulfur atoms in the dithiane ring contributes to its reactivity, allowing for nucleophilic substitution and other transformations. Additionally, the steric bulk of the triisopropylsilyl group can influence the compound's reactivity and selectivity in chemical reactions. Overall, 2-(triisopropylsilyl)-1,3-dithiane is valued in synthetic chemistry for its unique structural features and functional versatility.
Formula:C9H27ClSi4
InChI:InChI=1/C9H27ClSi4/c1-11(2,3)14(10,12(4,5)6)13(7,8)9/h1-9H3
SMILES:C[Si](C)(C)[Si](Cl)([Si](C)(C)C)[Si](C)(C)C
Synonyms:- 2-Triisopropylsilyl-1,3-dithiane
- 2-Chloro-1,1,1,3,3,3-Hexamethyl-2-(Trimethylsilyl)Trisilane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
