CymitQuimica logo

CAS 1452577-24-0

:

1-[5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-thiazolyl]ethanone

Description:
1-[5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-thiazolyl]ethanone is a chemical compound characterized by its unique structural features, which include a thiazole ring and a dioxaborolane moiety. The presence of the thiazole ring contributes to its potential biological activity, as thiazoles are often found in various pharmaceuticals and agrochemicals. The dioxaborolane group is notable for its ability to form stable complexes with various substrates, making it useful in synthetic chemistry, particularly in the context of boron chemistry. This compound may exhibit properties such as moderate solubility in organic solvents and stability under ambient conditions, although specific solubility and stability data would depend on the environment and conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents or as intermediates in organic synthesis. As with many boron-containing compounds, it may also participate in reactions that involve the formation of carbon-boron bonds, which are valuable in various synthetic pathways.
Formula:C11H16BNO3S
InChI:InChI=1S/C11H16BNO3S/c1-7(14)9-13-6-8(17-9)12-15-10(2,3)11(4,5)16-12/h6H,1-5H3
InChI key:InChIKey=YCNIPIQMCOSTLE-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2SC(C(C)=O)=NC2
Synonyms:
  • 1-[5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-thiazolyl]ethanone
  • Ethanone, 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-thiazolyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.