CAS 14527-51-6: 5,10,15,20-tetra-P-tolyl-21H,23H-porphine
Description:5,10,15,20-tetra-P-tolyl-21H,23H-porphine is a synthetic porphyrin compound characterized by its complex macrocyclic structure, which includes a central metal ion that can coordinate with various metals, enhancing its properties. This compound features four para-tolyl groups attached to the nitrogen-containing porphyrin ring, which contributes to its solubility and electronic properties. It typically exhibits strong absorption in the visible region of the electromagnetic spectrum, making it useful in applications such as photodynamic therapy, sensors, and as a dye in various chemical processes. The presence of the para-tolyl substituents can influence its electronic distribution, stability, and reactivity. Additionally, this porphyrin derivative can participate in various chemical reactions, including coordination with metal ions, which can alter its optical and electronic characteristics. Its unique properties make it a subject of interest in fields such as materials science, biochemistry, and photochemistry.
Formula:C48H38N4
InChI:InChI=1/C48H38N4/c1-29-5-13-33(14-6-29)45-37-21-23-39(49-37)46(34-15-7-30(2)8-16-34)41-25-27-43(51-41)48(36-19-11-32(4)12-20-36)44-28-26-42(52-44)47(40-24-22-38(45)50-40)35-17-9-31(3)10-18-35/h5-28,49-50H,1-4H3/b45-37-,45-38-,46-39-,46-41-,47-40-,47-42-,48-43-,48-44-
- Synonyms:
- 21H,23H-Porphin, 5,10,15,20-tetrakis(4-methylphenyl)-
- 5,10,15,20-Tetrakis(4-Methylphenyl)Porphyrin
- Tetrakis(4-methylphenyl)-porphine