CAS 1453-62-9
:2-(Dimethoxymethyl)furan
Description:
2-(Dimethoxymethyl)furan is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing one oxygen atom. This compound features two methoxy groups (-OCH3) attached to a methylene group (-CH2-) that is connected to the furan, enhancing its reactivity and solubility in organic solvents. It is typically a colorless to pale yellow liquid with a distinctive odor. The presence of the methoxy groups contributes to its polar nature, making it more soluble in polar solvents compared to non-polar ones. This compound is of interest in various chemical applications, including as a potential building block in organic synthesis and in the development of biofuels. Its reactivity can be attributed to the electron-donating effects of the methoxy groups, which can influence its behavior in chemical reactions. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if inhaled or ingested.
Formula:C7H10O3
InChI:InChI=1S/C7H10O3/c1-8-7(9-2)6-4-3-5-10-6/h3-5,7H,1-2H3
InChI key:InChIKey=XQYAKXNQOMNLKX-UHFFFAOYSA-N
SMILES:C(OC)(OC)C1=CC=CO1
Synonyms:- 2-Furaldehyde, dimethyl acetal
- 2-Furancarboxaldehyde dimethyl acetal
- Furan, 2-(dimethoxymethyl)-
- Furfural dimethyl acetal
- 2-(Dimethoxymethyl)furan
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-Furaldehyde dimethylacetal
CAS:2-Furaldehyde dimethylacetal is a monomer with a hydroxyl group and an aldehyde group in the molecule. It is produced by the reaction of formaldehyde with methanol and sodium hydroxide, which react to create formaldehyde hemiacetal. The formaldehyde hemiacetal then reacts with methanol to produce 2-furaldehyde dimethylacetal. This compound has been shown to polymerize when heated or irradiated with ultraviolet light, forming polymers. Gel chromatography can be used to separate this compound from other compounds in a mixture. The molecular weight of 2-furaldehyde dimethylacetal is 186g/mol.Formula:C7H10O3Purity:Min. 95 Area-%Color and Shape:Clear LiquidMolecular weight:142.15 g/mol


