CAS 1453-93-6: Protopanaxatriol
Description:Protopanaxatriol is a triterpenoid saponin primarily derived from ginseng species, particularly Panax ginseng. It is characterized by its unique chemical structure, which includes a dammarane skeleton with hydroxyl groups at specific positions, contributing to its biological activity. This compound is known for its potential pharmacological properties, including anti-inflammatory, antioxidant, and immunomodulatory effects. Protopanaxatriol is often studied for its role in enhancing cognitive function and its potential protective effects against various diseases. It is soluble in organic solvents and exhibits moderate solubility in water, which influences its bioavailability and therapeutic applications. Additionally, protopanaxatriol is often used in traditional medicine and is a subject of interest in nutraceutical research due to its health benefits. Its safety profile is generally favorable, but further studies are necessary to fully understand its mechanisms of action and potential side effects. Overall, protopanaxatriol represents a significant area of interest in both pharmacology and natural product chemistry.
Formula:C30H52O4
InChI:InChI=1S/C30H52O4/c1-18(2)10-9-13-30(8,34)19-11-15-28(6)24(19)20(31)16-22-27(5)14-12-23(33)26(3,4)25(27)21(32)17-29(22,28)7/h10,19-25,31-34H,9,11-17H2,1-8H3/t19-,20+,21-,22+,23-,24-,25-,27+,28+,29+,30+/m0/s1
InChI key:InChIKey=SHCBCKBYTHZQGZ-DLHMIPLTSA-N
SMILES:OC1CC2C3(C)CCC(O)C(C)(C)C3C(O)CC2(C)C4(C)CCC(C14)C(O)(C)CCC=C(C)C
- Synonyms:
- (3Beta,6Alpha,12Beta,14Beta)-Dammar-24-Ene-3,6,12,20-Tetrol
- (3b,6a,12b)-Dammar-24-ene-3,6,12,20-tetrol,(3beta,6alpha,12beta)-Protopanaxatriol
- (3Β,6Α,12Β)-Dammar-24-Ene-3,6,12,20-Tetrol
- (3β,6α,12β,20R)-Dammar-24-ene-3,6,12,20-tetrol
- 20(R)-Appt
- 20(R)-Protopanaxatriol
- Dammar-24-ene-3,6,12,20-tetrol, (3β,6α,12β,20R)-
- Dammar-24-ene-3β,6α,12β,20-tetrol, (20R)-
- Protopanaxatriol
- See more synonyms
