CAS 145300-45-4
:N-[4-(1,3-THIAZOLAN-2-YL)PHENYL]ACETAMIDE
Description:
N-[4-(1,3-Thiazolan-2-yl)phenyl]acetamide, with the CAS number 145300-45-4, is a chemical compound characterized by its thiazole and acetamide functional groups. This compound typically exhibits properties associated with both aromatic and heterocyclic chemistry, which may influence its solubility, reactivity, and biological activity. The thiazole ring contributes to its potential as a pharmacophore, often associated with various biological activities, including antimicrobial and anti-inflammatory effects. The presence of the acetamide group suggests that it may participate in hydrogen bonding, enhancing its interactions with biological targets. In terms of physical properties, compounds of this nature may be solid at room temperature and exhibit moderate to high melting points, depending on their molecular structure and intermolecular forces. Additionally, the compound's stability and reactivity can be influenced by the substituents on the aromatic ring and the thiazole moiety. Overall, N-[4-(1,3-thiazolan-2-yl)phenyl]acetamide represents a class of compounds with potential applications in medicinal chemistry and drug development.
Formula:C11H14N2OS
InChI:InChI=1/C11H14N2OS/c1-8(14)13-10-4-2-9(3-5-10)11-12-6-7-15-11/h2-5,11-12H,6-7H2,1H3,(H,13,14)
SMILES:CC(=Nc1ccc(cc1)C1NCCS1)O
Synonyms:- 4-(1,3-Thiazolan-2-yl)acetanilide
- 4-(1,3-Thiazolidin-2-yl)acetanilide
- N-[4-(1,3-thiazolidin-2-yl)phenyl]acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4-(1,3-Thiazolidin-2-yl)acetanilide
CAS:4-(1,3-Thiazolidin-2-yl)acetanilide
Molecular weight:222.31g/mol

