CAS 145306-65-6

3-Methoxy-D-phenylalanine

Description:

3-Methoxy-D-phenylalanine, also known by its CAS number 145306-65-6, is an amino acid derivative characterized by the presence of a methoxy group (-OCH3) attached to the aromatic ring of the phenylalanine structure. This compound is a chiral molecule, existing in the D-enantiomeric form, which can have distinct biological activities compared to its L-counterpart. The methoxy substitution can influence its solubility, stability, and interaction with biological systems, potentially affecting its role in metabolic pathways or as a precursor in the synthesis of other compounds. 3-Methoxy-D-phenylalanine may be of interest in pharmaceutical research, particularly in the development of drugs targeting neurological or metabolic disorders, due to its structural similarity to neurotransmitters and its potential effects on receptor activity. Additionally, its unique properties make it a subject of study in fields such as medicinal chemistry and biochemistry, where understanding the influence of functional groups on amino acid behavior is crucial.

Formula: C₁₀H₁₃NO₃

InChI: InChI=1/C10H13NO3/c1-14-8-4-2-3-7(5-8)6-9(11)10(12)13/h2-5,9H,6,11H2,1H3,(H,12,13)/t9-/m1/s1

SMILES: COc1cccc(c1)C[C@H](C(=O)O)N

Synonyms:

• D-3-MeO-Phe-OH
• D-3-Methoxyphenylalanine

D-Phenylalanine, 3-methoxy-

CAS: 145306-65-6

Formula: C₁₀H₁₃NO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 195.2151

Ref: IN-DA001KS6

(2R)-2-amino-3-(3-methoxyphenyl)propanoic acid

CAS: 145306-65-6

(2R)-2-amino-3-(3-methoxyphenyl)propanoic acid

Purity: 98%

Molecular weight: 195.22g/mol

Ref: 54-OR480385

3-Methoxy-D-phenylalanine

CAS: 145306-65-6

Formula: C₁₀H₁₃NO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 195.218

Ref: 10-F092806