CAS 14532-24-2
:1-Hexanesulfonyl chloride
Description:
1-Hexanesulfonyl chloride, with the CAS number 14532-24-2, is an organic compound characterized by the presence of a sulfonyl chloride functional group attached to a hexane chain. It is a colorless to pale yellow liquid that is typically used as a reagent in organic synthesis, particularly in the preparation of sulfonamides and other sulfonyl derivatives. The compound is known for its reactivity, especially towards nucleophiles, due to the electrophilic nature of the sulfonyl chloride group. It is soluble in organic solvents such as dichloromethane and ether but is generally insoluble in water. 1-Hexanesulfonyl chloride is sensitive to moisture and should be handled under anhydrous conditions to prevent hydrolysis, which can lead to the formation of the corresponding sulfonic acid. Safety precautions are essential when working with this compound, as it can be corrosive and irritating to the skin, eyes, and respiratory system. Proper storage in a cool, dry place, away from moisture and incompatible substances, is also recommended.
Formula:C6H13ClO2S
InChI:InChI=1S/C6H13ClO2S/c1-2-3-4-5-6-10(7,8)9/h2-6H2,1H3
InChI key:InChIKey=AEHJDQSLTMFLQO-UHFFFAOYSA-N
SMILES:C(CS(Cl)(=O)=O)CCCC
Synonyms:- 1-Hexanesulfonyl chloride
- 1-Hexyl sulfonyl chloride
- Hexane-1-Sulfonyl Chloride
- Hexanesulfonyl Chloride
- Hexylsulfonyl chloride
- n-Hexylsulfonyl chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Hexanesulfonyl chloride
CAS:Formula:C6H13ClO2SPurity:97%Color and Shape:LiquidMolecular weight:184.6842n-Hexyl sulfonyl chloride
CAS:Formula:C6H13ClO2SPurity:97%Color and Shape:LiquidMolecular weight:184.68n-Hexyl sulfonyl chloride
CAS:n-Hexyl sulfonyl chloride is a reactive aliphatic hydrocarbon that can be used to prepare conjugates with polymers. The compound class includes halides, alkyl sulfonates, and other compounds with a sulfur atom in the molecule. n-Hexyl sulfonyl chloride is prepared by reacting hexane with chlorosulfonic acid in the presence of water. The reaction products are then hydrolyzed to yield n-hexyl sulfonyl chloride and hydrochloric acid. This compound has been used as an intermediate for polymer conjugation reactions and an amide synthesis. It also inhibits skin cancer cell growth and can be used to inhibit herpes simplex virus replication in vitro.Formula:C6H13ClO2SPurity:Min. 95%Molecular weight:184.69 g/mol



