CAS 14534-61-3
:3,4-Dicaffeoylquinic acid
Description:
3,4-Dicaffeoylquinic acid is a polyphenolic compound belonging to the family of caffeoylquinic acids, which are esters formed from quinic acid and caffeic acid. This compound is characterized by its two caffeoyl groups attached to the 3 and 4 positions of the quinic acid backbone. It is typically found in various plants, particularly in coffee and certain fruits, contributing to their antioxidant properties. The compound exhibits significant biological activities, including anti-inflammatory, antimicrobial, and potential anticancer effects, making it of interest in nutritional and pharmaceutical research. Its structure allows for strong interactions with free radicals, enhancing its role as an antioxidant. Additionally, 3,4-dicaffeoylquinic acid is soluble in polar solvents, which facilitates its extraction from plant materials. The compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both food science and pharmacology. Overall, 3,4-dicaffeoylquinic acid is a valuable compound in the study of natural products and their health benefits.
Formula:C25H24O12
InChI:InChI=1S/C25H24O12/c26-15-5-1-13(9-17(15)28)3-7-21(31)36-20-12-25(35,24(33)34)11-19(30)23(20)37-22(32)8-4-14-2-6-16(27)18(29)10-14/h1-10,19-20,23,26-30,35H,11-12H2,(H,33,34)/t19-,20-,23-,25+/m1/s1
InChI key:InChIKey=UFCLZKMFXSILNL-BBLPPJRLSA-N
SMILES:O(C(C=CC1=CC(O)=C(O)C=C1)=O)[C@H]2[C@H](OC(C=CC3=CC(O)=C(O)C=C3)=O)C[C@@](C(O)=O)(O)C[C@H]2O
Synonyms:- (1R,4R,5R)-3,4-bis{[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}-1,5-dihydroxycyclohexanecarboxylic acid
- (1S,3R,4R,5R)-3,4-Bis[[3-(3,4-dihydroxyphenyl)-1-oxo-2-propenyl]oxy]-1,5-dihydroxycyclohexanecarboxylic acid
- (1S,3R,4R,5R)-3,4-bis{[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}-1,5-dihydroxycyclohexanecarboxylic acid
- 3,4-Dicaffeoylquinic acid
- Cinnamic acid, 3,4-dihydroxy-, 5-carboxy-3,5-dihydroxy-1,2-cyclohexylene ester, stereoisomer
- Cyclohexanecarboxylic acid, 3,4-bis[[3-(3,4-dihydroxyphenyl)-1-oxo-2-propenyl]oxy]-1,5-dihydroxy-, (1S,3R,4R,5R)-
- Cyclohexanecarboxylic acid, 3,4-bis[[3-(3,4-dihydroxyphenyl)-1-oxo-2-propenyl]oxy]-1,5-dihydroxy-, [1S-(1α,3β,4α,5α)]-
- Isochlorogenic acid B
- Isochlorogenic acid B,3,4-Dicaffeoylquinic acid
- Quinic acid 3,4-di-O-caffeate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 12 products.
3,4-Di-O-Caffeoyl quinic acid
CAS:3,4-Di-O-Caffeoyl quinic acid analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C25H24O12Purity:(HPLC) ≥97%Color and Shape:PowderMolecular weight:516.463,4-Dicaffeoylquinic acid
CAS:Formula:C25H24O12Purity:(HPLC) ≥ 98.0%Color and Shape:Off-white to pale yellow or grey-brown solidMolecular weight:516.46Isochlorogenic Acid B (3,4-Dicaffeoylquinic Acid)
CAS:Formula:C25H24O12Color and Shape:Yellow SolidMolecular weight:516.463,4-Dicaffeoylquinic acid
CAS:3,4-Dicaffeoylquinic acid (Isochlorogenic acid B) has antioxidant activity.Formula:C25H24O12Purity:96.33% - 98.82%Color and Shape:SolidMolecular weight:516.45Ref: TM-T6S1525
1mg40.00€5mg80.00€10mg101.00€25mg167.00€50mg240.00€100mg355.00€500mg845.00€1mL*10mM (DMSO)103.00€4,5-dicaffeoylquinic acid
CAS:Carboxylic acid with additional oxygen functionsFormula:C25H24O12Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:516.46Isochlorogenic Acid B (>85%)
CAS:Applications Isochlorgenic Acid is shown to provide antioxidant and DNA-protective activities.
References Xu, J. et al.: J. Agri. Food Chem., 60, 11625 (2012);Formula:C25H24O12Purity:>85%Color and Shape:NeatMolecular weight:516.453,4-Dicaffeoylquinic acid
CAS:3,4-Dicaffeoylquinic acid is a naturally occurring polyphenolic compound, which is predominantly found in various plants and herbal sources such as artichokes, echinacea, and certain species of coffee. Its structure consists of quinic acid esterified with two caffeic acid moieties, making it a member of the chlorogenic acid family. This compound is well-recognized for its potent antioxidant properties, exerting its effects by scavenging free radicals and reducing oxidative stress within biological systems.
Formula:C25H24O12Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:516.45 g/molRef: 3D-FD40706
Discontinued product










