CAS 145349-66-2

4-Bromo-2,5-difluoroIodobenzene

Description:

4-Bromo-2,5-difluoroiodobenzene is an aromatic halogenated compound characterized by the presence of bromine, iodine, and fluorine substituents on a benzene ring. The compound features a bromine atom at the para position (4) and two fluorine atoms at the meta positions (2 and 5) relative to the iodine atom, which is located at the ortho position (1). This specific arrangement of halogens contributes to its unique chemical properties, including its reactivity and potential applications in organic synthesis and materials science. The presence of multiple halogens can influence the compound's polarity, boiling point, and solubility in various solvents. Additionally, the compound may exhibit interesting electronic properties due to the electron-withdrawing nature of the halogens, which can affect its behavior in chemical reactions. As with many halogenated compounds, it is important to handle 4-bromo-2,5-difluoroiodobenzene with care, considering potential environmental and health impacts associated with halogenated organic compounds.

Formula: C₆H₂BrF₂I

InChI: InChI=1S/C6H2BrF2I/c7-3-1-5(9)6(10)2-4(3)8/h1-2H

SMILES: c1c(c(cc(c1F)I)F)Br

Synonyms:

• 1-Bromo-2,5-difluoro-4-iodobenzene
• 4-Bromo-2,5-difluoroIodobenzen

Benzene, 1-bromo-2,5-difluoro-4-iodo-

CAS: 145349-66-2

Formula: C₆H₂BrF₂I

Purity: 96%

Color and Shape: Solid

Molecular weight: 318.8854

Ref: IN-DA001KTO

4-Bromo-2,5-difluoroiodobenzene

CAS: 145349-66-2

4-Bromo-2,5-difluoroiodobenzene

Formula: C₆H₂BrF₂I

Purity: 97%

Color and Shape: off white crystalline needles

Molecular weight: 318.89g/mol

Ref: 54-PC2687

4-Bromo-2,5-difluoroiodobenzene

CAS: 145349-66-2

Formula: C₆H₂BrF₂I

Purity: 95%

Color and Shape: Solid

Molecular weight: 318.887

Ref: 10-F021411