CymitQuimica logo

CAS 145354-79-6

:

[4,4′-Bi-1,3-dioxolane]-2-methanol, 2′,2′-dimethyl-, 2-benzoate, (2S,4S,4′R)-

Description:
The chemical substance known as "[4,4′-Bi-1,3-dioxolane]-2-methanol, 2′,2′-dimethyl-, 2-benzoate, (2S,4S,4′R)-" with CAS number 145354-79-6 is a complex organic compound characterized by its unique structural features, including a bi-dioxolane framework and a benzoate functional group. This compound exhibits chirality, indicated by its specific stereochemical configuration (2S,4S,4′R), which can influence its reactivity and interactions in biological systems. The presence of the methanol and dimethyl substituents contributes to its solubility and potential applications in organic synthesis or as a pharmaceutical intermediate. Additionally, the benzoate moiety may enhance its stability and alter its physical properties, such as melting point and boiling point. Overall, this compound's intricate structure and functional groups suggest potential utility in various chemical applications, including drug development and materials science, although specific reactivity and application details would depend on further empirical studies.
Formula:C16H20O6
InChI:InChI=1S/C16H20O6/c1-16(2)20-9-13(22-16)12-8-18-14(21-12)10-19-15(17)11-6-4-3-5-7-11/h3-7,12-14H,8-10H2,1-2H3/t12-,13+,14-/m0/s1
InChI key:InChIKey=PDYNSSGHLKHKEP-MJBXVCDLSA-N
SMILES:C(OC(=O)C1=CC=CC=C1)[C@@H]2O[C@@](CO2)([C@@]3(OC(C)(C)OC3)[H])[H]
Synonyms:
  • [4,4′-Bi-1,3-dioxolane]-2-methanol, 2′,2′-dimethyl-, benzoate, (2S,4S,4′R)-
  • [4,4′-Bi-1,3-dioxolane]-2-methanol, 2′,2′-dimethyl-, benzoate, [2S-[2α,4α(S*)]]-
  • [4,4′-Bi-1,3-dioxolane]-2-methanol, 2′,2′-dimethyl-, 2-benzoate, (2S,4S,4′R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.