CAS 145356-41-8
:glutathione glycylethyl ester
Description:
Glutathione glycylethyl ester, identified by the CAS number 145356-41-8, is a derivative of glutathione, a tripeptide composed of glutamate, cysteine, and glycine. This compound is characterized by the presence of an ethyl ester group, which enhances its lipophilicity compared to its parent molecule, glutathione. This modification can facilitate cellular uptake and improve bioavailability, making it of interest in various biochemical and pharmacological applications. Glutathione itself is a crucial antioxidant in biological systems, playing a significant role in protecting cells from oxidative stress and maintaining redox balance. The esterification of glutathione may influence its reactivity and interaction with biological targets, potentially enhancing its therapeutic effects. Additionally, glutathione glycylethyl ester may be involved in various metabolic pathways and could serve as a substrate for enzymatic reactions. Overall, this compound represents a valuable tool in research related to oxidative stress, detoxification processes, and cellular signaling.
Formula:C15H25N3O8S
InChI:InChI=1/C15H25N3O8S/c1-3-26-12(22)6-17-14(24)10(7-27-15(25)8(2)19)18-13(23)9(16)4-5-11(20)21/h8-10,19H,3-7,16H2,1-2H3,(H,17,24)(H,18,23)(H,20,21)/t8-,9+,10+/m1/s1
Synonyms:- Gsh-Et
- Gsh-(glycyl)ethyl ester
- Glutathione glycylethyl ester
- Glycine, N-(N-L-gamma-glutamyl-S-(2-hydroxy-1-oxopropyl)-L-cysteinyl)-, ethyl ester, (R)-
- ethyl L-alpha-glutamyl-S-[(2R)-2-hydroxypropanoyl]-L-cysteinylglycinate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Glutathione glycylethyl ester
CAS:Glutathione glycylethyl ester, a hydrophilic PAO derivative, blocks angiogenesis and cancer growth.Formula:C15H25N3O8SColor and Shape:SolidMolecular weight:407.44
