CAS 14537-01-0: 3-fluoro-3-deoxy-D-xylofuranose
Description:3-Fluoro-3-deoxy-D-xylofuranose is a modified sugar derivative characterized by the presence of a fluorine atom at the 3-position of the furanose ring, which is a five-membered cyclic form of the sugar. This compound is a deoxy sugar, meaning it lacks a hydroxyl group at the 3-position, replaced by a fluorine atom. The presence of the fluorine can significantly influence the compound's chemical reactivity, stability, and biological activity, making it of interest in various fields, including medicinal chemistry and biochemistry. The furanose form suggests that it can participate in typical carbohydrate reactions, such as glycosylation, but the fluorine substitution may alter its interaction with enzymes and receptors. Additionally, 3-fluoro-3-deoxy-D-xylofuranose may exhibit unique properties in terms of solubility and polarity compared to its non-fluorinated counterparts. Its structural modifications can also impact its potential applications in drug design and development, particularly in creating analogs of nucleosides or other biologically relevant molecules.
Formula:C5H9FO4
InChI:InChI=1/C5H9FO4/c6-3-2(1-7)10-5(9)4(3)8/h2-5,7-9H,1H2/t2-,3+,4-,5?/m1/s1
- Synonyms:
- 3-deoxy-3-fluoro-D-xylofuranose
D-Xylose, 3-deoxy-3-fluoro-
Ref: IN-DA001KUR
| Undefined size | To inquire |
3-Deoxy-3-fluoro-D-xylofuranose - Aqueous solution
Ref: 3D-MD03412
| 5mg | 147.00 € | ||
| 10mg | 186.00 € | ||
| 25mg | 255.00 € | ||
| 50mg | 377.00 € |
3-Deoxy-3-fluoro-D-xylose (10% w/w in H2O)
Controlled ProductRef: TR-D235170
| 5mg | 266.00 € | ||
| 50mg | 1,786.00 € |
