CAS 145397-25-7
:Aids004544
Description:
The chemical substance identified by the CAS number 145397-25-7 is known as "Aids004544." This compound is a synthetic molecule that has been studied primarily for its potential applications in medicinal chemistry, particularly in the context of antiviral research. It exhibits specific biological activity, which may involve interactions with viral proteins or host cell mechanisms. The structure of Aids004544 typically includes functional groups that enhance its solubility and bioavailability, making it a candidate for further pharmacological evaluation. Its characteristics may include moderate to high potency against targeted viral strains, along with a defined mechanism of action that could involve inhibition of viral replication or entry into host cells. Additionally, safety and toxicity profiles are essential considerations in its development, necessitating thorough preclinical and clinical assessments. Overall, Aids004544 represents a class of compounds that are being explored for their therapeutic potential in treating viral infections, particularly those associated with HIV/AIDS.
Formula:C8H10FN3O4
InChI:InChI=1/C8H10FN3O4/c9-4-1-12(8(14)11-7(4)10)5-3-15-6(2-13)16-5/h1,5-6,13H,2-3H2,(H2,10,11,14)/t5-,6-/m1/s1
Synonyms:- (+/-)-Fdoc
- (+/-)-1-[2-(Hydroxymethyl)-1-4-dioxolan-4-yl]-5-fluorocytosine
- 4-amino-5-fluoro-1-[(2S,4S)-2-(hydroxymethyl)-1,3-dioxolan-4-yl]pyrimidin-2-one
- 2(1H)-Pyrimidinone, 4-amino-5-fluoro-1-[(2R,4R)-2-(hydroxymethyl)-1,3-dioxolan-4-yl]-, rel-
- Emtricitabine Impurity 4
- (+/-)-5F-Dioxolane-c
- Aids-004544
- Emtricitabine dioxopentycline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
