CAS 1454-53-1: 3-Piperidinecarboxylic acid, 4-oxo-1-(phenylmethyl)-, ethyl ester, hydrochloride (1:1)
Description:3-Piperidinecarboxylic acid, 4-oxo-1-(phenylmethyl)-, ethyl ester, hydrochloride (1:1), with CAS number 1454-53-1, is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a carboxylic acid functional group and an ester moiety, indicating its potential for reactivity and solubility in various solvents. The presence of the phenylmethyl group suggests that it may exhibit aromatic properties, which can influence its interactions and stability. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, making it easier to handle in laboratory settings. The compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. Its specific properties, such as melting point, boiling point, and spectral characteristics, would require further investigation through experimental methods or detailed literature review for precise data.
Formula:C15H19NO3·ClH
InChI:InChI=1S/C15H19NO3.ClH/c1-2-19-15(18)13-11-16(9-8-14(13)17)10-12-6-4-3-5-7-12;/h3-7,13H,2,8-11H2,1H3;1H
InChI key:InChIKey=YPFMNHZRNXPYBG-UHFFFAOYSA-N
SMILES:Cl.O=C(OCC)C1C(=O)CCN(CC=2C=CC=CC2)C1
- Synonyms:
- 1-Benzyl-3-(ethoxycarbonyl)-4-piperidone hydrochloride
- 1-Benzyl-4-oxopiperidine-3-carboxylic acid ethyl ester hydrochloride
- 3-Piperidinecarboxylic acid, 4-oxo-1-(phenylmethyl)-, ethyl ester, hydrochloride
- 3-Piperidinecarboxylic acid, 4-oxo-1-(phenylmethyl)-, ethyl ester, hydrochloride (1:1)
- Ethyl 1-Benzyl-4-Oxo-3-Piperidinecarboxylate Hydrochloride
- Ethyl 1-benzyl-4-oxopiperidine-3-carboxylate hydrochloride
- N-Benzyl-3-carbethoxy-4-piperidone hydrochloride
- N-Benzyl-4-piperidone-3-carboxylic acid ethyl ester hydrochloride
- NSC 15156
- Nipecotic acid, 1-benzyl-4-oxo-, ethyl ester, hydrochloride
- See more synonyms
