CAS 145400-03-9: (1R,3aR,4R,7S,7aR)-Octahydro-3a,7-dimethyl-1-(2-methyl-1-propen-1-yl)-1H-indene-4,7-diol

Description:The chemical substance known as (1R,3aR,4R,7S,7aR)-Octahydro-3a,7-dimethyl-1-(2-methyl-1-propen-1-yl)-1H-indene-4,7-diol, with the CAS number 145400-03-9, is a bicyclic compound characterized by its complex polycyclic structure. It features multiple stereocenters, which contribute to its chiral nature, influencing its biological activity and interactions. The presence of hydroxyl (-OH) groups indicates that it is a diol, which can participate in hydrogen bonding, affecting its solubility and reactivity. The compound's structure suggests potential applications in the fragrance industry or as a precursor in organic synthesis due to its unique functional groups. Additionally, the presence of a propenyl group may impart reactivity typical of alkenes, allowing for further chemical transformations. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical properties, which is crucial for its potential applications in various fields, including pharmaceuticals and materials science.

Formula:C₁₅H₂₆O₂

InChI:InChI=1S/C15H26O2/c1-10(2)9-11-5-7-14(3)12(16)6-8-15(4,17)13(11)14/h9,11-13,16-17H,5-8H2,1-4H3/t11-,12-,13-,14+,15+/m1/s1

InChI key:InChIKey=FKMCEEHVCIIPLE-ZSAUSMIDSA-N

SMILES:OC1CCC(O)(C)C2C(C=C(C)C)CCC12C

Synonyms:
(1R,3aR,4R,7S,7aR)-Octahydro-3a,7-dimethyl-1-(2-methyl-1-propen-1-yl)-1H-indene-4,7-diol
1H-Indene-4,7-diol, octahydro-3a,7-dimethyl-1-(2-methyl-1-propenyl)-, [1R-(1a,3ab,4b,7b,7aa)]-
1H-Indene-4,7-diol,octahydro-3a,7-dimethyl-1-(2-methyl-1-propenyl)-, (1R,3aR,4R,7S,7aR)-
Homalomenol A
1H-Indene-4,7-diol, octahydro-3a,7-dimethyl-1-(2-methyl-1-propen-1-yl)-, (1R,3aR,4R,7S,7aR)-

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Homalomenol A REF: TM-TN4217CAS: 145400-03-9	98%	To inquire	Thu 27 Mar 25
Homalomenol A REF: BP-SBP00940CAS: 145400-03-9	95%~99%	To inquire	Mon 31 Mar 25
Homalomenol A REF: 3D-VFA40003CAS: 145400-03-9	Min. 95%	331.00 €~2,655.00 €	Wed 07 May 25