CAS 145400-03-9

(1R,3aR,4R,7S,7aR)-Octahydro-3a,7-dimethyl-1-(2-methyl-1-propen-1-yl)-1H-indene-4,7-diol

Description:

The chemical substance known as (1R,3aR,4R,7S,7aR)-Octahydro-3a,7-dimethyl-1-(2-methyl-1-propen-1-yl)-1H-indene-4,7-diol, with the CAS number 145400-03-9, is a bicyclic compound characterized by its complex polycyclic structure. It features multiple stereocenters, which contribute to its chiral nature, influencing its biological activity and interactions. The presence of hydroxyl (-OH) groups indicates that it is a diol, which can participate in hydrogen bonding, affecting its solubility and reactivity. The compound's structure suggests potential applications in the fragrance industry or as a precursor in organic synthesis due to its unique functional groups. Additionally, the presence of a propenyl group may impart reactivity typical of alkenes, allowing for further chemical transformations. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical properties, which is crucial for its potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₁₅H₂₆O₂

InChI: InChI=1S/C15H26O2/c1-10(2)9-11-5-7-14(3)12(16)6-8-15(4,17)13(11)14/h9,11-13,16-17H,5-8H2,1-4H3/t11-,12-,13-,14+,15+/m1/s1

InChI key: InChIKey=FKMCEEHVCIIPLE-ZSAUSMIDSA-N

SMILES: C[C@]12[C@@]([C@@H](C=C(C)C)CC1)([C@@](C)(O)CC[C@H]2O)[H]

Synonyms:

• (1R,3aR,4R,7S,7aR)-Octahydro-3a,7-dimethyl-1-(2-methyl-1-propen-1-yl)-1H-indene-4,7-diol
• 1H-Indene-4,7-diol, octahydro-3a,7-dimethyl-1-(2-methyl-1-propenyl)-, [1R-(1a,3ab,4b,7b,7aa)]-
• 1H-Indene-4,7-diol,octahydro-3a,7-dimethyl-1-(2-methyl-1-propenyl)-, (1R,3aR,4R,7S,7aR)-
• Homalomenol A
• 1H-Indene-4,7-diol, octahydro-3a,7-dimethyl-1-(2-methyl-1-propen-1-yl)-, (1R,3aR,4R,7S,7aR)-

Homalomenol A

CAS: 145400-03-9

Homalomenol A is a natural product of Homalomena, Araceae.

Formula: C₁₅H₂₆O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 238.371

Ref: TM-TN4217

Homalomenol A

CAS: 145400-03-9

Formula: C₁₅H₂₆O₂

Purity: 95%~99%

Color and Shape: Oil

Molecular weight: 238.371

Ref: BP-SBP00940

Homalomenol A

CAS: 145400-03-9

Homalomenol A is a bioactive compound, specifically a type of sesquiterpenoid, which is derived from the Homalomena species of plants. These plants are primarily found in tropical regions such as Southeast Asia. Homalomenol A exerts its effects through diverse biochemical interactions, including modulation of enzymatic pathways and potential receptor binding, which contribute to its pharmacological activity.

Formula: C₁₅H₂₆O₂

Purity: Min. 95%

Molecular weight: 238.37 g/mol

Ref: 3D-VFA40003