CAS 14541-93-6
:6-NITRO-2-BENZOXAZOLETHIOL
Description:
6-Nitro-2-benzoxazolethiol is an organic compound characterized by its heterocyclic structure, which includes a benzoxazole ring and a thiol group. The presence of a nitro group at the 6-position of the benzoxazole contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and materials science. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many heterocyclic compounds. Its thiol group imparts unique reactivity, allowing for participation in nucleophilic substitution reactions and the formation of disulfide bonds. Additionally, the nitro group can undergo reduction reactions, making it a versatile intermediate in synthetic chemistry. The compound may also exhibit fluorescence properties, which can be useful in analytical applications. Safety considerations should be taken into account due to the presence of the nitro group, which can pose hazards in terms of reactivity and toxicity. Overall, 6-nitro-2-benzoxazolethiol is a valuable compound in chemical research and development.
Formula:C7H4N2O3S
InChI:InChI=1/C7H4N2O3S/c10-9(11)4-1-2-5-6(3-4)12-7(13)8-5/h1-3H,(H,8,13)
SMILES:c1cc2c(cc1N(=O)=O)oc(n2)S
Synonyms:- 2-Benzoxazolethiol, 6-nitro-
- 2-Mercapto-6-nitrobenzoxazole
- 6-Nitro-1,3-benzoxazole-2-thiol
- 6-nitro-1,3-benzoxazole-2(3H)-thione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2(3H)-Benzoxazolethione, 6-nitro-
CAS:Formula:C7H4N2O3SPurity:97%Color and Shape:SolidMolecular weight:196.18336-Nitrobenzo[d]oxazole-2(3H)-thione
CAS:6-Nitrobenzo[d]oxazole-2(3H)-thionePurity:97%Molecular weight:196.18g/mol6-Nitro-benzooxazole-2-thiol
CAS:6-Nitro-benzooxazole-2-thiol is a heterocyclic amine that has been used as an inorganic base. It is synthesized from 6-nitrobenzooxazole and 2-mercaptobenzimidazole using elemental sulfur and solvents. 6-Nitrobenzooxazole-2-thiol can be used to produce a wide variety of organic compounds, including sulfides, which are useful for eliminating pesticides. This compound also has antitubercular activity and can be used as a sulfur source for elemental sulfur.Formula:C7H4N2O3SPurity:Min. 95%Molecular weight:196.18 g/mol



