CAS 1454288-88-0

Ethyl 2-[5-[3′-(methylsulfonyl)biphenyl-4-yl]-3-(trifluoromethyl)-1H-pyrazol-1-yl]acetate

Description:

Ethyl 2-[5-[3′-(methylsulfonyl)biphenyl-4-yl]-3-(trifluoromethyl)-1H-pyrazol-1-yl]acetate, identified by its CAS number 1454288-88-0, is a synthetic organic compound characterized by its complex molecular structure. It features an ethyl acetate moiety linked to a pyrazole ring, which is further substituted with a trifluoromethyl group and a biphenyl unit that carries a methylsulfonyl group. This compound is likely to exhibit unique chemical properties due to the presence of electron-withdrawing groups, such as the trifluoromethyl and methylsulfonyl groups, which can influence its reactivity and solubility. The biphenyl structure may contribute to its stability and potential interactions in biological systems. Ethyl 2-[5-[3′-(methylsulfonyl)biphenyl-4-yl]-3-(trifluoromethyl)-1H-pyrazol-1-yl]acetate may be of interest in pharmaceutical research, particularly in the development of new therapeutic agents, owing to its potential biological activity and structural diversity. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₂₁H₁₉F₃N₂O₄S

InChI: InChI=1S/C21H19F3N2O4S/c1-3-30-20(27)13-26-18(12-19(25-26)21(22,23)24)15-9-7-14(8-10-15)16-5-4-6-17(11-16)31(2,28)29/h4-12H,3,13H2,1-2H3

InChI key: InChIKey=ZUMNJDGBYXHASJ-UHFFFAOYSA-N

SMILES: C(C(OCC)=O)N1C(=CC(C(F)(F)F)=N1)C2=CC=C(C=C2)C3=CC(S(C)(=O)=O)=CC=C3

Rovazolac

CAS: 1454288-88-0

Rovazolac

Purity: ≥98%

Molecular weight: 452.45g/mol

Ref: 54-BUP04979

Rovazolac

Controlled Product

CAS: 1454288-88-0

Formula: C₂₁H₁₉F₃N₂O₄S

Color and Shape: Neat

Molecular weight: 452.447

Ref: TR-R685005

Rovazolac

CAS: 1454288-88-0

Rovazolac (ALX-101) is a liver x receptor (LXR) modulator used in the study of immune system disorders and atopic dermatitis.

Formula: C₂₁H₁₉F₃N₂O₄S

Purity: 99.35%

Color and Shape: Solid

Molecular weight: 452.45

Ref: TM-T16792