CymitQuimica logo

CAS 145438-95-5

:

(2R,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid

Description:
(2R,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid is a bicyclic compound characterized by its unique structural features, which include a saturated indole framework. This compound contains a carboxylic acid functional group, contributing to its acidity and potential reactivity. The stereochemistry indicated by the (2R,3aR,7aS) designation suggests specific spatial arrangements of its atoms, which can influence its biological activity and interactions with other molecules. Typically, compounds like this may exhibit properties such as solubility in polar solvents, moderate stability under standard conditions, and potential applications in pharmaceuticals or as intermediates in organic synthesis. The presence of the indole moiety often correlates with various biological activities, making such compounds of interest in medicinal chemistry. Additionally, the octahydro structure implies that it is a fully saturated derivative, which may affect its physical properties, such as melting point and boiling point, compared to unsaturated analogs. Overall, this compound's characteristics make it a subject of interest in both synthetic and medicinal chemistry contexts.
Formula:C9H15NO2
InChI:InChI=1S/C9H15NO2/c11-9(12)8-5-6-3-1-2-4-7(6)10-8/h6-8,10H,1-5H2,(H,11,12)/t6-,7+,8-/m1/s1
InChI key:InChIKey=CQYBNXGHMBNGCG-GJMOJQLCSA-N
SMILES:C(O)(=O)[C@H]1C[C@@]2([C@@](N1)(CCCC2)[H])[H]
Synonyms:
  • (2R,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid
  • 1H-Indole-2-carboxylic acid, octahydro-, [2R-(2α,3aβ,7aα)]-
  • 1H-Indole-2-carboxylic acid, octahydro-, (2R,3aR,7aS)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.