CAS 145438-97-7
:dinitrosocaffeidine
Description:
Dinitrosocaffeidine, with the CAS number 145438-97-7, is a chemical compound derived from caffeine, characterized by the presence of two nitro groups attached to the caffeidine structure. This compound typically exhibits a yellow to orange coloration, which is common among nitro-substituted aromatic compounds due to the presence of conjugated systems that absorb light in the visible spectrum. Dinitrosocaffeidine is known for its potential applications in various fields, including analytical chemistry and as a reagent in organic synthesis. Its reactivity is influenced by the nitro groups, which can participate in electrophilic substitution reactions. Additionally, the compound may exhibit biological activity, although specific studies on its pharmacological properties are limited. As with many nitro compounds, safety precautions should be taken when handling dinitrosocaffeidine, as nitro groups can be associated with toxicity and environmental concerns. Overall, dinitrosocaffeidine represents an interesting subject for further research in both synthetic and applied chemistry contexts.
Formula:C7H10N6O3
InChI:InChI=1/C7H10N6O3/c1-11-4-8-6(12(2)9-15)5(11)7(14)13(3)10-16/h4H,1-3H3
Synonyms:- 1H-Imidazole-5-carboxamide, N,1-dimethyl-4-(methylnitrosoamino)-N-nitroso-
- N,1-Dimethyl-4-(methylnitrosoamino)-N-nitroso-1H-imidazole-5-carboxamide
- CCRIS 6611
- Dinitrosocaffeidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
N,N'-Dinitroso Caffeine EP Impurity E (N,N'-Dinitroso Caffeidine)
CAS:Formula:C7H10N6O3Molecular weight:226.20


