CymitQuimica logo

CAS 145452-04-6

:

allyl (2R)-2-acetamido-3-sulfanyl-propanoate

Description:
Allyl (2R)-2-acetamido-3-sulfanyl-propanoate, with the CAS number 145452-04-6, is an organic compound characterized by its unique functional groups and structural features. It contains an allyl group, which is a vinyl group with a terminal double bond, contributing to its reactivity in various chemical reactions. The presence of an acetamido group indicates that it has an amide functional group, which can influence its solubility and biological activity. Additionally, the sulfanyl (thiol) group imparts distinct properties, such as increased nucleophilicity and potential for forming disulfide bonds. This compound is likely to exhibit moderate polarity due to the combination of hydrophobic (allyl) and hydrophilic (acetamido and sulfanyl) components. Its structural configuration suggests potential applications in organic synthesis, pharmaceuticals, or as a biochemical probe, although specific applications would depend on further research into its reactivity and biological interactions. Overall, the compound's characteristics make it a subject of interest in both synthetic and medicinal chemistry.
Formula:C8H13NO3S
InChI:InChI=1/C8H13NO3S/c1-3-4-12-8(11)7(5-13)9-6(2)10/h3,7,13H,1,4-5H2,2H3,(H,9,10)/t7-/m0/s1
SMILES:C=CCOC(=O)[C@H](CS)N=C(C)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.