CAS 1454558-58-7

2,5-Dioxo-1-pyrrolidinyl 5-[[[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]methyl]amino]-5-oxopentanoate

Description:

2,5-Dioxo-1-pyrrolidinyl 5-[[[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]methyl]amino]-5-oxopentanoate, identified by its CAS number 1454558-58-7, is a complex organic compound characterized by its unique structural features, including a pyrrolidine ring and a tetrazine moiety. This compound exhibits properties typical of both heterocyclic and aromatic compounds, which may contribute to its potential biological activity. The presence of multiple functional groups, such as carbonyls and amines, suggests that it may engage in various chemical reactions, including nucleophilic substitutions and hydrogen bonding. Its molecular structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the tetrazine group, which is known for its reactivity and ability to form stable complexes. Additionally, the compound's solubility and stability in different solvents can vary, influencing its behavior in biological systems. Overall, this compound represents a significant interest in research areas focused on drug design and development.

Formula: C₁₉H₂₀N₆O₅

InChI: InChI=1S/C19H20N6O5/c1-12-21-23-19(24-22-12)14-7-5-13(6-8-14)11-20-15(26)3-2-4-18(29)30-25-16(27)9-10-17(25)28/h5-8H,2-4,9-11H2,1H3,(H,20,26)

InChI key: InChIKey=SAFWEESCGQHGHJ-UHFFFAOYSA-N

SMILES: C(NC(CCCC(ON1C(=O)CCC1=O)=O)=O)C2=CC=C(C=C2)C=3N=NC(C)=NN3

Synonyms:

• 2,5-Dioxo-1-pyrrolidinyl 5-[[[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]methyl]amino]-5-oxopentanoate
• Pentanoic acid, 5-[[[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]methyl]amino]-5-oxo-, 2,5-dioxo-1-pyrrolidinyl ester

Bz-(Me)Tz-NHS

CAS: 1454558-58-7

Bz-(Me)Tz-NHS

Purity: ≥95%

Molecular weight: 412.4g/mol

Ref: 54-BUP05660

Bz-(Me)Tz-NHS

CAS: 1454558-58-7

Bz-(Me)Tz-NHS is an aliphatic compound containing a methyltetrazine moiety, which is selective and allows the synthesis of a wide range of active molecules.

Formula: C₁₉H₂₀N₆O₅

Purity: 97.48%

Color and Shape: Soild

Molecular weight: 412.4

Ref: TM-T83659