CAS 14548-45-9
:(4-Bromophenyl)-3-pyridinylmethanone
Description:
(4-Bromophenyl)-3-pyridinylmethanone, with the CAS number 14548-45-9, is an organic compound characterized by its distinct functional groups and structural features. It consists of a brominated phenyl group attached to a pyridinylmethanone moiety, which contributes to its potential reactivity and biological activity. The presence of the bromine atom enhances its electrophilic character, making it useful in various chemical reactions, including substitution and coupling reactions. The pyridine ring introduces heteroatoms into the structure, which can influence solubility and interaction with biological targets. This compound may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, making it of interest in medicinal chemistry. Its molecular structure allows for various synthetic modifications, which can lead to the development of derivatives with enhanced efficacy or selectivity. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, are influenced by its molecular interactions and the presence of functional groups. Safety and handling precautions should be observed due to the presence of bromine and potential toxicity.
Formula:C12H8BrNO
InChI:InChI=1S/C12H8BrNO/c13-11-5-3-9(4-6-11)12(15)10-2-1-7-14-8-10/h1-8H
InChI key:InChIKey=IDGVUIHZWDVXOQ-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(Br)C=C1)C=2C=CC=NC2
Synonyms:- (4-Bromophenyl)(Pyridin-3-Yl)Methanone
- (4-Bromophenyl)-3-pyridinylmethanone
- 3-(4-Bromobenzoyl)pyridine
- Ketone, p-bromophenyl 3-pyridyl
- Methanone, (4-bromophenyl)-3-pyridinyl-
- p-Bromophenyl 3-pyridyl ketone
- 4-Bromophenyl 3-pyridyl ketone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methanone, (4-bromophenyl)-3-pyridinyl-
CAS:Formula:C12H8BrNOPurity:95%Color and Shape:SolidMolecular weight:262.1020(4-Bromophenyl)(pyridin-3-yl)methanone
CAS:(4-Bromophenyl)(pyridin-3-yl)methanonePurity:95%Molecular weight:262.10g/mol(4-Bromophenyl)-(pyridin-3-yl)methanone
CAS:The compound is a reactive, logistic and logistic regression analysis. The logistic regression was used to determine the effects of temperature on the yields of this organic chemical. The compound is not active against test organisms such as dimethylamine, but does react with carbonyl groups in other organic chemicals. This chemical is considered reactive because it can be easily oxidized by air or water. It has been shown that this chemical reacts with oxygen molecules to form aldehydes and ketones.Formula:C12H8BrNOPurity:Min. 95%Molecular weight:262.1 g/mol



